
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2024-54-6 |
| Catalog No. | 2A-0153635 |
| Chinese Name | 7-甲基咪唑[1,2-A]吡啶-2-甲醛 |
| Synonyms | ethyl 2-bromo-3-methyl-4,4,4-trifluorobutyrate; Aethyl-2-brom-3-trifluormethyl-butyrat; ethyl 2-bromo-4,4,4-trifluoroisovalerate |
| Molecular Formula | C6H6O3Br1F3 |
| Molecular Weight | 263.01 |
| Purity | 96+ |
| Density | 1.478g/cm3 |
| Boiling Point | 178-180ºC |
| EINECS | 0 |
| HTC | 2915900090 |
| UN(IATA) | 0 |
| PubChem ID | 5099904 |
| MDL Number | MFCD00207670 |
| SMILES | CCOC(=O)C(Br)C(C)C(F)(F)F |
| InChI | InChI=1S/C7H10BrF3O2/c1-3-13-6(12)5(8)4(2)7(9,10)11/h4-5H,3H2,1-2H3 |
| InChI Key | GNKFSVGWVCDYSV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| ETHYL 2-BROMO-2-CYANOACETATE | 1187-46-8 | 2A-0153626 |
| ETHYL 2-BROMO-2-CYCLOHEXYLACETATE | 42716-73-4 | 2A-0153627 |
| ETHYL 2-BROMO-2-CYCLOPROPYLACETATE | 1200828-74-5 | 2A-0153628 |
| ETHYL 2-BROMO-2-FLUORO-3-OXO-3-PHENYLPROPANOATE | 139101-23-8 | 2A-0153629 |
| ETHYL 2-BROMO-3-OXOBUTANOATE | 609-13-2 | 2A-0153634 |
| ETHYL 2-BROMO-4,4,4-TRIFLUOROBUTANOATE | 367-33-9 | 2A-0153637 |
| ETHYL 2-BROMO-5-HYDROXYBENZOATE | 102297-71-2 | 2A-0153647 |
| ETHYL 2-BROMO-5-NITROBENZOATE | 208176-31-2 | 2A-0153648 |
| ETHYL 2-BROMODECANOATE | 6974-85-2 | 2A-0153655 |
| ETHYL 2-BUTYL-2-CYANOHEXANOATE | 67105-41-3 | 2A-0153667 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA