
CAS Number1604-11-1
SynonymsDimethyl 2-methylsuccinate; Butanedioic acid, methyl-, dimethyl ester; MFCD00008449; Butanedioic acid,methyl-,dimethyl ester; DIMETHYL METHYLSUCCINATE; Succinic acid,methyl-,dimethyl ester; dimethyl 2-methylbutanedioate; EINECS 216-506-1; Succinic acid, methyl-, dimethyl ester; Butanedioic acid, 2-methyl-, dimethyl ester
Molecular FormulaCH3O2CCH2CH(CH3)CO2CH3
Molecular Weight160.17
Purity96+%
Density1.1±0.1 g/cm3
Boiling Point196.0±0.0 °C at 760 mmHg
EINECS216-506-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1604-11-1 |
| Catalog No. | 2A-0152525 |
| Chinese Name | 甲基丁二酸二甲酯 |
| Synonyms | Dimethyl 2-methylsuccinate; Butanedioic acid, methyl-, dimethyl ester; MFCD00008449; Butanedioic acid,methyl-,dimethyl ester; DIMETHYL METHYLSUCCINATE; Succinic acid,methyl-,dimethyl ester; dimethyl 2-methylbutanedioate; EINECS 216-506-1; Succinic acid, methyl-, dimethyl ester; Butanedioic acid, 2-methyl-, dimethyl ester |
| Molecular Formula | CH3O2CCH2CH(CH3)CO2CH3 |
| Molecular Weight | 160.17 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 196.0±0.0 °C at 760 mmHg |
| Storage Condition | Room temperature, avoid light, ventilated and dry |
| EINECS | 216-506-1 |
| HTC | 2917190090 |
| UN(IATA) | 0 |
| PubChem ID | 24850770 |
| MDL Number | MFCD00008449 |
| SMILES | COC(=O)CC(C)C(=O)OC |
| InChI | InChI=1S/C7H12O4/c1-5(7(9)11-3)4-6(8)10-2/h5H,4H2,1-3H3 |
| InChI Key | NFOQJNGQQXICBY-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DIMETHYL 2-BROMOPENTANEDIOATE | 760-94-1 | 2A-0152516 |
| DIMETHYL 2-CHLORO-5-NITROTEREPHTHALATE | 32888-86-1 | 2A-0152517 |
| DIMETHYL 2-IODOTEREPHTHALATE | 165534-79-2 | 2A-0152521 |
| DIMETHYL 2-METHYLHEPTANEDIOATE | 33658-48-9 | 2A-0152522 |
| DIMETHYL 2-METHYLISOPHTHALATE | 28269-31-0 | 2A-0152524 |
| DIMETHYL 2-NITROISOPHTHALATE | 57052-99-0 | 2A-0152526 |
| DIMETHYL 2-OXOSUCCINATE | 25007-54-9 | 2A-0152529 |
| DIMETHYL 3-AMINOPHTHALATE | 34529-06-1 | 2A-0152533 |
| DIMETHYL 4-FLUOROPHTHALATE | 110706-50-8 | 2A-0152549 |
| DIMETHYL 4-HYDROXYPHTHALATE | 22479-95-4 | 2A-0152551 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA