
CAS Number52411-34-4
Synonyms2-[2-(2-aminophenoxy)ethoxy]phenylamine; 2-[2-(2-aminophenoxy)ethoxy]aniline; 2,2'-[1,2-Ethanediylbis(oxy)]dianiline; 2,2'-[ethane-1,2-diylbis(oxy)]dianiline
Molecular FormulaC14H16O2N2
Molecular Weight244.29
Purity98%
Density1.2±0.1 g/cm3
Boiling Point452.9±30.0 °C at 760 mmHg
Melting Point133°C
AppearanceOff-white crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52411-34-4 |
| Catalog No. | 2A-9001521 |
| Chinese Name | 2,2'-二氨基乙二醇二苯醚 |
| Synonyms | 2-[2-(2-aminophenoxy)ethoxy]phenylamine; 2-[2-(2-aminophenoxy)ethoxy]aniline; 2,2'-[1,2-Ethanediylbis(oxy)]dianiline; 2,2'-[ethane-1,2-diylbis(oxy)]dianiline |
| Molecular Formula | C14H16O2N2 |
| Molecular Weight | 244.29 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 452.9±30.0 °C at 760 mmHg |
| Melting Point | 133°C |
| Appearance | Off-white crystal |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| MDL Number | MFCD00087648 |
| SMILES | Nc1ccccc1OCCOc1ccccc1N |
| InChI | InChI=1S/C14H16N2O2/c15-11-5-1-3-7-13(11)17-9-10-18-14-8-4-2-6-12(14)16/h1-8H,9-10,15-16H2 |
| InChI Key | PSDFQEVOCCOOET-UHFFFAOYSA-N |
| MSDS | msds/1521_1_52411_34_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Trifluoromethoxy)phenylacetonitrile | 137218-25-8 | 2A-9001501 |
| 2-(Trifluoromethoxy)phenylhydrazine hydrochloride | 2A-101502 | 2A-9001502 |
| 2, 4-Dinitrobromobenzene | 584-48-5 | 2A-9001515 |
| 2,15-Hexadecanedione | 18650-13-0 | 2A-9001519 |
| 2,2'-(5-Methyl-1,3-phenylene)di(2-methylpropanenitrile) | 120511-72-0 | 2A-9001520 |
| 2,2,2-Trichloroethane-1,1-diol | 302-17-0 | 2A-9001523 |
| 2,2,3,3,4,4,4-Heptafluoro-1-butanol | 375-01-9 | 2A-9001525 |
| 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol | 376-90-9 | 2A-9001527 |
| 2,2,3,3-Tetrafluoro-1-propanol | 76-37-9 | 2A-9001528 |
| 2,2,3,4,4,4-Hexafluoro-1-butanol | 382-31-0 | 2A-9001529 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA