![BICYCLO[2.2.2]OCTANE-1-CARBOXYLIC ACID structure, CAS 699-55-8](/structures/180000/151321_2_699_55_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 699-55-8 |
| Catalog No. | 2A-0151321 |
| Chinese Name | 双环[2.2.2]辛烷-1-羧酸 |
| Synonyms | bicyclo[2.2.2]octane carboxylic acid; bicyclo[2.2.2]octane-4-carboxylic acid; Bicyclo[2.2.2]octane-1-carboxylic acid |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 274.3±8.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2916209090 |
| UN(IATA) | 0 |
| PubChem ID | 428331 |
| SMILES | O=C(O)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C9H14O2/c10-8(11)9-4-1-7(2-5-9)3-6-9/h7H,1-6H2,(H,10,11) |
| InChI Key | PUNFICOCZAPAJV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| BICYCLO[2.2.1]HEPTA-2,5-DIENE-2,3-DICARBOXYLIC ACID | 15872-28-3 | 2A-0151313 |
| BICYCLO[2.2.1]HEPTAN-2-OL | 1632-68-4 | 2A-0151314 |
| BICYCLO[2.2.1]HEPTANE-2,3-DICARBOXYLIC ACID | 1724-08-9 | 2A-0151315 |
| BICYCLO[2.2.1]HEPTANE-2,7-DIYL DIACETATE | 17290-00-5 | 2A-0151317 |
| BICYCLO[2.2.1]HEPTANE-7-CARBOXYLIC ACID | 5971-67-5 | 2A-0151319 |
| BOC-(R)-3-AMINO-3-PHENYLPROPANAL | 212560-65-1 | 2A-0151409 |
| BOC-(S)-3-AMINO-3-PHENYLPROPANAL | 135865-78-0 | 2A-0151412 |
| CINNOLINE | 253-66-7 | 2A-0151904 |
| CINNOLINE-4-CARBALDEHYDE | 90418-57-8 | 2A-0151907 |
| CINNOLINE-4-CARBOXYLIC ACID | 21905-86-2 | 2A-0151908 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA