
CAS Number13461-74-0
Synonyms9-ethynylfluoren-9-ol; 9-Ethynyl-9H-fluoren-9-ol; L B656 HHJ HQ H1UU1; 9-Ethynyl-9-hydroxyfluorene; 9-Ethynyl-9-fluorenol; (9-Hydroxy-9-fluorenyl)acetylene; MFCD00041555
Molecular FormulaC14H12O
Molecular Weight196.251
Purity96+%
Density1.3±0.1 g/cm3
Boiling Point375.2±31.0 °C at 760 mmHg
Melting Point107-110 °C
AppearanceCrystalline Powder and Chunks | Off-white
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13461-74-0 |
| Catalog No. | 2A-0150571 |
| Chinese Name | 9-乙炔-9-芴醇 |
| Synonyms | 9-ethynylfluoren-9-ol; 9-Ethynyl-9H-fluoren-9-ol; L B656 HHJ HQ H1UU1; 9-Ethynyl-9-hydroxyfluorene; 9-Ethynyl-9-fluorenol; (9-Hydroxy-9-fluorenyl)acetylene; MFCD00041555 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.251 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 375.2±31.0 °C at 760 mmHg |
| Melting Point | 107-110 °C |
| Appearance | Crystalline Powder and Chunks | Off-white |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| EINECS | 0 |
| HTC | 2906299090 |
| UN(IATA) | 0 |
| PubChem ID | 3181010 |
| MDL Number | MFCD00183690 |
| SMILES | C#CC1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H10O/c1-2-15(16)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h1,3-10,16H |
| InChI Key | MMZVVJGCZZAWBN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 9-BENZYL-2-CHLORO-9H-PURIN-6-AMINE | 56046-25-4 | 2A-0150539 |
| 9-BROMO-2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE HYDROCHLORIDE | 172078-42-1 | 2A-0150550 |
| 9-CHLORO-2-METHOXYACRIDINE | 16492-13-0 | 2A-0150562 |
| 9-CHLORO-3,4-DIHYDRO-1H-BENZO[B]AZEPIN-5(2H)-ONE | 247237-56-5 | 2A-0150563 |
| 9-CHLORO-3,4-DIHYDROBENZO[B]OXEPIN-5(2H)-ONE | 141106-24-3 | 2A-0150564 |
| 9-FLUORO-4,5-DIHYDRO-1H-BENZO[B]AZEPIN-2(3H)-ONE | 1151397-80-6 | 2A-0150580 |
| 9-HYDROXYNONANOIC ACID | 3788-56-5 | 2A-0150584 |
| 9-IODOANTHRACENE | 22362-86-3 | 2A-0150586 |
| 9-METHYLUNDECANOIC ACID | 17001-17-1 | 2A-0150593 |
| 9-OCTYLHEPTADECAN-9-OL | 17687-72-8 | 2A-0150594 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA