
CAS Number1006-47-9
SynonymsT66 BNJ JI; 8-Iodo quinoline; Quinoline,8-iodo; 8-Iodoquinoline; 8-Jod-chinolin; iodo-8 quinoleine
Molecular FormulaC9H6IN
Molecular Weight255.06
Purity96+%
Density1.8±0.1 g/cm3
Boiling Point320.7±15.0 °C at 760 mmHg
Melting Point33 °C
AppearanceSolid;Light yellow to Yellow to Orange powder to crystal
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1006-47-9 |
| Catalog No. | 2A-0150370 |
| Chinese Name | 8-碘喹啉 |
| Synonyms | T66 BNJ JI; 8-Iodo quinoline; Quinoline,8-iodo; 8-Iodoquinoline; 8-Jod-chinolin; iodo-8 quinoleine |
| Molecular Formula | C9H6IN |
| Molecular Weight | 255.06 |
| Purity | 96+ |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 320.7±15.0 °C at 760 mmHg |
| Melting Point | 33 °C |
| Appearance | Solid;Light yellow to Yellow to Orange powder to crystal |
| Storage Condition | 0-10°C; store in inert gas; avoid air, heat |
| EINECS | 0 |
| HTC | 2933499090 |
| UN(IATA) | 0 |
| PubChem ID | 29200705 |
| SMILES | Ic1cccc2cccnc12 |
| InChI | InChI=1S/C9H6IN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-6H |
| InChI Key | OBEGSKDGFBFMFJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-FLUOROQUINOLINE-2,4(1H,3H)-DIONE | 148356-14-3 | 2A-0150341 |
| 8-FLUOROQUINOLINE-2-CARBALDEHYDE | 904369-10-4 | 2A-0150342 |
| 8-HYDROXY-2-METHYLQUINOLINE-4-CARBOXYLIC ACID | 14788-40-0 | 2A-0150345 |
| 8-HYDROXY-2-METHYLQUINOLINE-7-CARBOXYLIC ACID | 23051-08-3 | 2A-0150347 |
| 8-IODOQUINAZOLINE-2,4(1H,3H)-DIONE | 959236-79-4 | 2A-0150369 |
| 8-METHOXY-1-METHYLISOQUINOLINE | 1231948-70-1 | 2A-0150379 |
| 8-METHOXY-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLE | 126912-70-7 | 2A-0150381 |
| 8-METHOXY-2,3-DIHYDRO-1H-PYRROLO[1,2-A]INDOL-1-ONE | 137075-39-9 | 2A-0150382 |
| 8-METHOXY-4-OXO-2-PHENYL-4H-CHROMENE-5,7-DIYL DIACETATE | 23246-80-2 | 2A-0150390 |
| 8-METHOXYCHROMAN-3-ONE | 91520-00-2 | 2A-0150394 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA