
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 628731-58-8 |
| Catalog No. | 2A-0150307 |
| Chinese Name | 8-氟-Α-四氢萘酮 |
| Synonyms | 8-fluoro-1-tetralone |
| Molecular Formula | C10H9O1F1 |
| Molecular Weight | 164.18 |
| Purity | 96+ |
| Density | 1.198g/cm3 |
| Boiling Point | 267.8ºC at 760 mmHg |
| Appearance | light brown solid |
| Storage Condition | 2-8°C, dry, sealed |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| PubChem ID | 16337039 |
| MDL Number | MFCD09027687 |
| SMILES | O=C1CCCc2cccc(F)c21 |
| InChI | InChI=1S/C10H9FO/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1,3,5H,2,4,6H2 |
| InChI Key | RYMWBQHSBRCBQV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-CHLORO-4-METHYLQUINOLIN-2(1H)-ONE | 54904-38-0 | 2A-0150257 |
| 8-CHLOROPYRAZINO[2,3-D]PYRIDAZIN-5-AMINE | 17258-01-4 | 2A-0150286 |
| 8-CHLOROQUINAZOLIN-2-AMINE | 1185113-73-8 | 2A-0150288 |
| 8-CHLOROQUINAZOLIN-4-AMINE | 19808-37-8 | 2A-0150289 |
| 8-CHLOROQUINAZOLIN-4-OL | 101494-95-5 | 2A-0150290 |
| 8-FLUORO-2,3-DIHYDROQUINOLIN-4-ONE | 38470-28-9 | 2A-0150310 |
| 8-FLUORO-2-METHYLQUINOLIN-4-OL | 5288-22-2 | 2A-0150313 |
| 8-FLUORO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE HYDROCHLORIDE | 1210389-26-6 | 2A-0150316 |
| 8-FLUOROQUINOLIN-2(1H)-ONE | 71738-83-5 | 2A-0150337 |
| 8-FLUOROQUINOLIN-4(1H)-ONE | 934000-16-5 | 2A-0150338 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA