
CAS Number7385-87-7
Synonyms2-Naphthol,8-bromo; 8-bromanylnaphthalen-2-ol; 1-bromo-7-naphthol; 8-Bromo-2-Naphthalenol; 7-hydroxy-1-bromo-naphthalene; 8-Bromo-2-naphthol; 8-Brom-2-hydroxy-naphthalin; 8-bromo-naphtol; 8-Brom-<2>naphthol
Molecular FormulaC10H7BrO
Molecular Weight223.07
Purity96+%
Density1.6±0.1 g/cm3
Boiling Point353.8±15.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7385-87-7 |
| Catalog No. | 2A-1150198 |
| Chinese Name | 8-溴萘-2-醇 |
| Synonyms | 2-Naphthol,8-bromo; 8-bromanylnaphthalen-2-ol; 1-bromo-7-naphthol; 8-Bromo-2-Naphthalenol; 7-hydroxy-1-bromo-naphthalene; 8-Bromo-2-naphthol; 8-Brom-2-hydroxy-naphthalin; 8-bromo-naphtol; 8-Brom-<2>naphthol |
| Molecular Formula | C10H7BrO |
| Molecular Weight | 223.07 |
| Purity | 96+ |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 353.8±15.0 °C at 760 mmHg |
| Storage Condition | Room temperature, store in inert gas |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| PubChem ID | 8698140 |
| SMILES | Oc1ccc2cccc(Br)c2c1 |
| InChI | InChI=1S/C10H7BrO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-6,12H |
| InChI Key | PJRXIIFRDDJZSP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-BROMO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE HYDROCHLORIDE | 625394-66-3 | 2A-0150115 |
| 8-BROMO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE | 651735-60-3 | 2A-0150116 |
| 8-BROMO-6-FLUORO-2,2-DIMETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE | 688363-74-8 | 2A-0150158 |
| 8-BROMO-6-FLUORO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE | 688363-49-7 | 2A-0150160 |
| 8-BROMO-7-FLUOROQUINOLIN-2(1H)-ONE | 1001322-86-6 | 2A-0150182 |
| 8-BROMOPYRAZINO[2,3-D]PYRIDAZIN-5(6H)-ONE | 17257-99-7 | 2A-0150200 |
| 8-BROMOQUINOXALIN-2(1H)-ONE | 1092563-82-0 | 2A-0150212 |
| 8-CHLORO-2-ETHOXYQUINOLIN-4-OL | 861396-95-4 | 2A-0150236 |
| 8-CHLORO-2-HYDROXY-4H-BENZO[D][1,3]OXAZIN-4-ONE | 63497-60-9 | 2A-0150237 |
| 8-CHLORO-2-METHYLQUINAZOLIN-4(1H)-ONE | 19407-54-6 | 2A-0150241 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA