
CAS Number1237-75-8
Synonyms7-bromo-3-hydroxy-2-naphth-o-amisidide; MFCD00004077; Naphtol AS-BI; C.I.Azoic Coupling Component 45; EINECS 248-048-3; 6-bromo-2-hydroxy-N-o-hydroxyphenylnaphthalene-3-carboxamide; NAPHTHOL AS-BI
Molecular FormulaC18H15O3N1
Molecular Weight293.32
Purity96+%
Density4.01 g/mL at 25 °C(lit.)
Boiling Point467.3ºC at 760mmHg
Melting Point1387 °C
EINECS0
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1237-75-8 |
| Catalog No. | 2A-0149279 |
| Chinese Name | 色酚 AS-BI |
| Synonyms | 7-bromo-3-hydroxy-2-naphth-o-amisidide; MFCD00004077; Naphtol AS-BI; C.I.Azoic Coupling Component 45; EINECS 248-048-3; 6-bromo-2-hydroxy-N-o-hydroxyphenylnaphthalene-3-carboxamide; NAPHTHOL AS-BI |
| Molecular Formula | C18H15O3N1 |
| Molecular Weight | 293.32 |
| Purity | 96+ |
| Density | 4.01 g/mL at 25 °C(lit.) |
| Boiling Point | 467.3ºC at 760mmHg |
| Melting Point | 1387 °C |
| Storage Condition | This product should be sealed and stored below 0℃. |
| Packaging | III |
| EINECS | 0 |
| HTC | 2924299090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00021630 |
| SMILES | COc1ccccc1NC(=O)c1cc2cc(Br)ccc2cc1O |
| InChI | InChI=1S/C18H14BrNO3/c1-23-17-5-3-2-4-15(17)20-18(22)14-9-12-8-13(19)7-6-11(12)10-16(14)21/h2-10,21H,1H3,(H,20,22) |
| InChI Key | JIEINYQEXWLMCU-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/149279_1_1237_75_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-BROMO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE HYDROCHLORIDE | 1350738-87-2 | 2A-0149264 |
| 7-BROMO-3,4-DIHYDROBENZO[B]OXEPIN-5(2H)-ONE | 55580-08-0 | 2A-0149268 |
| 7-BROMO-3,4-DIHYDROQUINAZOLIN-2(1H)-ONE | 1207175-68-5 | 2A-0149270 |
| 7-BROMO-3,4-DIHYDROQUINOLIN-2(1H)-ONE | 14548-51-7 | 2A-0149272 |
| 7-BROMO-3-CHLORO-5H-BENZO[4,5]CYCLOHEPTA[1,2-B]PYRIDIN-5-ONE | 917878-65-0 | 2A-0149275 |
| 7-BROMO-3-NITROQUINOLIN-4-OL | 723280-94-2 | 2A-0149283 |
| 7-BROMO-3-PHENYLQUINOLIN-2(1H)-ONE | 861872-50-6 | 2A-0149284 |
| 7-BROMO-4,5-DIHYDRO-1H-BENZO[B]AZEPIN-2(3H)-ONE | 53841-99-9 | 2A-0149287 |
| 7-BROMO-4-CHLOROISOQUINOLIN-1(2H)-ONE | 223671-87-2 | 2A-0149296 |
| 7-BROMO-5-CHLOROINDOLIN-2-ONE | 215433-19-5 | 2A-0149315 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA