
CAS Number59626-33-4
Synonyms2-(tribromomethylsulfonyl)pyridine; MFCD02093493; 2-[(Tribromomethyl)sulfonyl]-pyridine; 2-[(Tribromomethyl)sulfonyl]pyridine; 2-Tribromo methyl Sulfonyl Pyridine
Molecular FormulaC6H4O2N1Br3S1
Molecular Weight393.88
Purity98%
Density2.4±0.1 g/cm3
Boiling Point400.7±45.0 °C at 760 mmHg
Melting Point159-162°C
AppearanceWhite to light yellow crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59626-33-4 |
| Catalog No. | 2A-9001486 |
| Chinese Name | 2-(三溴甲磺酰基)吡啶 |
| Synonyms | 2-(tribromomethylsulfonyl)pyridine; MFCD02093493; 2-[(Tribromomethyl)sulfonyl]-pyridine; 2-[(Tribromomethyl)sulfonyl]pyridine; 2-Tribromo methyl Sulfonyl Pyridine |
| Molecular Formula | C6H4O2N1Br3S1 |
| Molecular Weight | 393.88 |
| Purity | 98 |
| Density | 2.4±0.1 g/cm3 |
| Boiling Point | 400.7±45.0 °C at 760 mmHg |
| Melting Point | 159-162°C |
| Appearance | White to light yellow crystals |
| Storage Condition | Store in a sealed container in a cool, dry place |
| HTC | 2933399090 |
| MDL Number | MFCD02093493 |
| SMILES | O=S(=O)(c1ccccn1)C(Br)(Br)Br |
| InChI Key | FRCQMXHPNJVPJC-UHFFFAOYSA-N |
| MSDS | msds/1486_1_59626_33_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(Hydroxymethyl)benzo[b]thiophene | 17890-56-1 | 2A-9001470 |
| 2-(Methylamino)pyridine | 4597-87-9 | 2A-9001472 |
| 2-(Methylthio)pyrazine | 21948-70-9 | 2A-9001476 |
| 2-(Naphthalen-1-ylamino)thiazole-4-carboxylic acid | 165682-87-1 | 2A-9001479 |
| 2-(Thiophene-2-carboxamido)acetic acid | 2A-101485 | 2A-9001485 |
| 2,1,3-Benzothiadiazole | 273-13-2 | 2A-9001516 |
| 2,1,3-Benzothiadiazole-4-sulphonyl chloride | 73713-79-8 | 2A-9001517 |
| 2,1,3-Benzothiadiazole-5-carbonyl chloride | 321309-31-3 | 2A-9001518 |
| 2,2,5-Trimethyl-1,3-dioxane-4,6-dione | 3709-18-0 | 2A-9001532 |
| 2,2'-Anhydro-1(beta-D-arabinofuranosyl)uracil | 3736-77-4 | 2A-9001534 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA