
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 676348-51-9 |
| Catalog No. | 2A-9001480 |
| Chinese Name | 2-(萘-1-羰基)-3-氧丁酸甲酯 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 409.46 |
| Purity | 98 |
| HTC | 2918300090 |
| MDL Number | MFCD08282469 |
| SMILES | [S](=O)(=O)(NC(=O)OC)c1ccc(cc1)CCNC(=O)N2CC(=C(C2=O)CC)C |
| InChI | 1S/C18H23N3O6S/c1-4-15-12(2)11-21(16(15)22)17(23)19-10-9-13-5-7-14(8-6-13)28(25,26)20-18(24)27-3/h5-8H,4,9-11H2,1-3H3,(H,19,23)(H,20,24) |
| InChI Key | UZDRZEOOIXNUTE-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/1480_1_676348_51_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Difluoromethoxy)bromobenzene | 175278-33-8 | 2A-9001464 |
| 2-(Difluoromethoxy)phenylacetonitrile | 41429-22-5 | 2A-9001465 |
| 2-(Ethoxymethylene)-3-oxo-butanoic acid,ethyl ester | 3788-94-1 | 2A-9001467 |
| 2-(Hexafluoro-2-hydroxyisopropyl)aniline | 2A-101469 | 2A-9001469 |
| 2-(Methylformate)benzylsulfonamide | 112941-26-1 | 2A-9001474 |
| 2-(Nitroimino)imidazolidine | 5465-96-3 | 2A-9001481 |
| 2-(Pyridin-4-yl)-2,3-dihydroquinazolin-4(1H)-one | 2A-101483 | 2A-9001483 |
| 2-(Trifluoromethoxy)benzenesulfonamide | 37526-59-3 | 2A-9001489 |
| 2-(Trifluoromethoxy)benzoic acid | 1979-29-9 | 2A-9001490 |
| 2-(Trifluoromethoxy)benzonitrile | 63968-85-4 | 2A-9001491 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA