CAS Number123-92-2
SynonymsAcetic acid 3-methylbutyl ester,Isoamyl acetate; acetic acid isopentyl ester; Banana oil; ACETATE AMYLE; EINECS 204-662-3; 3-methyl-1-butyl acetate; isopentyl acetate; iso-pentyl acetate; FEMA 2055; 1-Butanol, 3-methyl-, acetate; ISOAMYLACETAT; (3-Methylbutyl) ethanoate; isoamyl ethanoate; femanumber2055; i-amylacetate; 3-methyl-1-butanol acetate; MFCD00008946; Isoamyl acetate; isomyl acetate; 3-Methylbutyl acetate
Molecular FormulaCH3COOCH2CH2CH(CH3)2
Molecular Weight130.18
Purity≥97%
Density0.9±0.1 g/cm3
Boiling Point142 °C/756 mmHg (lit.)
Melting Point−78 °C (lit.)
AppearanceColorless liquid with a banana smell
EINECS204-662-3
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 123-92-2 |
| Catalog No. | 2A-9014660 |
| Chinese Name | 乙酸异戊酯 |
| Synonyms | Acetic acid 3-methylbutyl ester,Isoamyl acetate; acetic acid isopentyl ester; Banana oil; ACETATE AMYLE; EINECS 204-662-3; 3-methyl-1-butyl acetate; isopentyl acetate; iso-pentyl acetate; FEMA 2055; 1-Butanol, 3-methyl-, acetate; ISOAMYLACETAT; (3-Methylbutyl) ethanoate; isoamyl ethanoate; femanumber2055; i-amylacetate; 3-methyl-1-butanol acetate; MFCD00008946; Isoamyl acetate; isomyl acetate; 3-Methylbutyl acetate |
| Molecular Formula | CH3COOCH2CH2CH(CH3)2 |
| Molecular Weight | 130.18 |
| Purity | ≥97 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 142 °C/756 mmHg (lit.) |
| Melting Point | −78 °C (lit.) |
| Appearance | Colorless liquid with a banana smell |
| Water Solubility | 0.20 g/100 mL. Slightly soluble |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | III |
| EINECS | 204-662-3 |
| HTC | 2915390090 |
| PubChem ID | 24900822 |
| MDL Number | MFCD00008946 |
| SMILES | CC(C)CCOC(C)=O |
| InChI | 1S/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 |
| InChI Key | MLFHJEHSLIIPHL-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1744750 |
| NACRES Code | NA.21 |
| UNSPSC | 12164502 |
| Hazard Symbols | 3 |
| MSDS | msds/14660_1_123_92_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Iron(II) sulfate dihydrate | 10028-21-4 | 2A-9014655 |
| Iron(II) tetrafluoroborate | 15283-51-9 | 2A-9014656 |
| Iron(III) bromide | 10031-26-2 | 2A-9014657 |
| Iron(III) sulfate pentahydrate | 142906-29-4 | 2A-9014658 |
| Isatin | 91-56-5 | 2A-9014659 |
| Isoamyl alcohol | 123-51-3 | 2A-9014661 |
| Isoamyl butyrate | 106-27-4 | 2A-9014662 |
| Isobornyl methacrylate | 7534-94-3 | 2A-9014663 |
| Isobutanol | 78-83-1 | 2A-9014664 |
| Isobutyl 4-hydroxybenzoate | 4247-02-3 | 2A-9014665 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS