
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97914-59-5 |
| Catalog No. | 2A-9001461 |
| Chinese Name | 2-(二氟甲氧基)苯甲酸 |
| Synonyms | MFCD00236223; 2-(difluoromethoxy)benzoic acid |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.12800 |
| Purity | 98 |
| Density | 1.370 |
| Boiling Point | 273.6ºC at 760mmHg |
| Melting Point | 98-100°C |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| HTC | 2918990090 |
| SMILES | O=C(O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
| InChI Key | AGDOJFCUKQMLHD-UHFFFAOYSA-N |
| MSDS | msds/1461_1_97914_59_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Biphenyl-4-carbonyl)-3-oxo-butyric acid methyl ester | 676348-60-0 | 2A-9001448 |
| 2-(Bromovinyl)benzene | 103-64-0 | 2A-9001455 |
| 2-(Butylamino)ethylamine | 19522-69-1 | 2A-9001456 |
| 2-(Chloroethyoxy)benzene | 622-86-6 | 2A-9001457 |
| 2-(Difluoromethoxy)aniline | 22236-04-0 | 2A-9001459 |
| 2-(Difluoromethoxy)benzonitrile | 56935-78-5 | 2A-9001462 |
| 2-(Difluoromethoxy)benzyl bromide | 85684-64-6 | 2A-9001463 |
| 2-(Difluoromethoxy)bromobenzene | 175278-33-8 | 2A-9001464 |
| 2-(Difluoromethoxy)phenylacetonitrile | 41429-22-5 | 2A-9001465 |
| 2-(Ethoxymethylene)-3-oxo-butanoic acid,ethyl ester | 3788-94-1 | 2A-9001467 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA