
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1006-68-4 |
| Catalog No. | 2A-0145965 |
| Chinese Name | 5-苯基-1,3-恶唑 |
| Synonyms | 5-Phenyl-1,3-oxazole |
| Molecular Formula | C9H7O1N1 |
| Molecular Weight | 145.16 |
| Purity | 96+ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 261.6±9.0 °C at 760 mmHg |
| Melting Point | 37-39ºC |
| Appearance | Light yellow to orange crystalline low melting point |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| EINECS | 0 |
| HTC | 2934999090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00067074 |
| SMILES | c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C9H7NO/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H |
| InChI Key | YPYPBEGIASEWKA-UHFFFAOYSA-N |
| MSDS | msds/145965_1_1006_68_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-OXOPYRROLIDINE-2-CARBOXAMIDE | 5626-52-8 | 2A-0145952 |
| 5-OXOPYRROLIDINE-3-CARBOXAMIDE | 14466-21-8 | 2A-0145954 |
| 5-PHENOXYFURAN-2-CARBOXYLIC ACID | 60698-32-0 | 2A-0145957 |
| 5-PHENOXYISOBENZOFURAN-1(3H)-ONE | 57830-14-5 | 2A-0145958 |
| 5-PHENYL-1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID | 37937-62-5 | 2A-0145960 |
| 5-PHENYL-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID | 7200-46-6 | 2A-0145968 |
| 5-PHENYL-1H-INDOLE | 66616-72-6 | 2A-0145972 |
| 5-PHENYL-3-(4-PHENYLPYRIDIN-2-YL)-1,2,4-TRIAZINE | 108775-05-9 | 2A-0145975 |
| 5-PHENYLISOXAZOLE-3-CARBALDEHYDE | 59985-82-9 | 2A-0145980 |
| 5-PHENYLTHIAZOLE | 1826-13-7 | 2A-0145993 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA