
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 590359-98-1 |
| Catalog No. | 2A-0144232 |
| Chinese Name | 5-氯-2-[(2-氯苄基)氧基]苯甲醛 |
| Molecular Formula | C14H10O2Cl2 |
| Molecular Weight | 281.14 |
| Purity | 96+ |
| Density | 1.34g/cm3 |
| Boiling Point | 412.1ºC at 760 mmHg |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| MDL Number | MFCD03422423 |
| SMILES | O=Cc1cc(Cl)ccc1OCc1ccccc1Cl |
| InChI Key | PMWQGKXPTBTDOF-UHFFFAOYSA-N |
| MSDS | msds/144232_1_590359_98_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5-BROMO-4-METHYLPICOLINALDEHYDE | 886364-94-9 | 2A-0143762 |
| 5-BROMO-6-(CHLOROMETHYL)BENZO[D][1,3]DIOXOLE | 64603-67-4 | 2A-0143780 |
| 5-BROMO-6-METHYLPICOLINALDEHYDE | 137778-18-8 | 2A-0143829 |
| 5-CHLORO-2-((2-CHLORO-4-FLUOROBENZYL)OXY)BENZALDEHYDE | 667436-66-0 | 2A-0144230 |
| 5-CHLORO-2-((2-CHLORO-6-FLUOROBENZYL)OXY)BENZALDEHYDE | 667436-65-9 | 2A-0144231 |
| 5-CHLORO-2-((2-FLUOROBENZYL)OXY)BENZALDEHYDE | 590360-21-7 | 2A-0144233 |
| 5-CHLORO-2-((2-METHYLBENZYL)OXY)BENZALDEHYDE | 590360-24-0 | 2A-0144234 |
| 5-CHLORO-2-((3-CHLOROBENZYL)OXY)BENZALDEHYDE | 590360-20-6 | 2A-0144235 |
| 5-CHLORO-2-((3-FLUOROBENZYL)OXY)BENZALDEHYDE | 667437-25-4 | 2A-0144236 |
| 5-CHLORO-2-((3-METHOXYBENZYL)OXY)BENZALDEHYDE | 667412-71-7 | 2A-0144237 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA