
CAS Number26968-58-1
SynonymsP-ETHYLBENZYL CHLORIDE; (chloromethyl)ethyl-benzene; 4-ETHYLBENZYL CHLORIDE; Ethylbenzyl Chloride (EBC); MFCD00039357; Benzene,(chloromethyl)ethyl; Ethyl Benzyl Chlorides; 1-(Chloromethyl)-3-ethylbenzene; EINECS 248-148-7; Toluene,a-chloro-ar-ethyl; ETHYL BENZYL CHLORIDE; (chloromethyl)ethyl-benzen
Molecular FormulaC9H11Cl
Molecular Weight154.637
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point215.5±9.0 °C at 760 mmHg
Melting Point-21ºC
AppearanceTransparent to light yellow liquid
EINECS287-090-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26968-58-1 |
| Catalog No. | 2A-9014409 |
| Chinese Name | 乙基苄基氯 |
| Synonyms | P-ETHYLBENZYL CHLORIDE; (chloromethyl)ethyl-benzene; 4-ETHYLBENZYL CHLORIDE; Ethylbenzyl Chloride (EBC); MFCD00039357; Benzene,(chloromethyl)ethyl; Ethyl Benzyl Chlorides; 1-(Chloromethyl)-3-ethylbenzene; EINECS 248-148-7; Toluene,a-chloro-ar-ethyl; ETHYL BENZYL CHLORIDE; (chloromethyl)ethyl-benzen |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.637 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 215.5±9.0 °C at 760 mmHg |
| Melting Point | -21ºC |
| Appearance | Transparent to light yellow liquid |
| EINECS | 287-090-7 |
| MDL Number | MFCD00951259 |
| SMILES | CCc1ccccc1CCl |
| InChI | InChI=1S/C9H11Cl/c1-2-8-5-3-4-6-9(8)7-10/h3-6H,2,7H2,1H3 |
| InChI Key | InChIKey=IYRCFBNKBGBMIT-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 77101502 |
| MSDS | msds/14409_1_26968_58_1.pdf |
| Transport Info | Product name: Ethylbenzyl chloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl nitrite | 109-95-5 | 2A-9014402 |
| Ethyl oleate | 111-62-6 | 2A-9014403 |
| Ethyl phenylacetate | 101-97-3 | 2A-9014404 |
| Ethyl stearate | 111-61-5 | 2A-9014406 |
| Ethylamine | 75-04-7 | 2A-9014408 |
| Ethylene carbonate | 96-49-1 | 2A-9014411 |
| Ethylene glycol | 107-21-1 | 2A-9014413 |
| Ethylene glycol diacetate | 111-55-7 | 2A-9014414 |
| Ethylene glycol monobutyl ether | 111-76-2 | 2A-9014415 |
| Ethylene glycol monoethyl ether | 110-80-5 | 2A-9014416 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA