
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18915-53-2 |
| Catalog No. | 2A-9001434 |
| Chinese Name | 2-(4-硝基苯基)丙二醛 |
| Synonyms | 2-(4-nitrophenyl)propanedial |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 233.18 |
| Purity | 96 |
| Density | 1.323g/cm3 |
| Boiling Point | 333.3ºC at 760 mmHg |
| Melting Point | 255-257 °C (dec.) (lit.) |
| HTC | 2913000090 |
| PubChem ID | 24866498 |
| MDL Number | MFCD00094261 |
| SMILES | OC(=O)c1ccc(o1)-c2ccc(cc2)[N+]([O-])=O |
| InChI | 1S/C11H7NO5/c13-11(14)10-6-5-9(17-10)7-1-3-8(4-2-7)12(15)16/h1-6H,(H,13,14) |
| InChI Key | FXZTYDPWMQBTDH-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/1434_1_18915_53_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(2-Hydroxycarbonyl-6-pyridyl)malondialdehyde | 212755-80-1 | 2A-9001338 |
| 2-(3-Hydroxycarbonyl-6-pyridyl)malondialdehyde | 212755-81-2 | 2A-9001363 |
| 2-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)ethanohydrazide | 175137-56-1 | 2A-9001379 |
| 2-(4-Chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylic acid hydrazide | 175137-34-5 | 2A-9001395 |
| 2-(4-Hydroxycarbonyl-2-nitrophenyl)malondialdehyde | 205985-96-2 | 2A-9001412 |
| 2-(4-Trichloromethylthiophenoxy)-5-nitrotoluene | 2A-101438 | 2A-9001438 |
| 2-(Benzenesulfonyl)propionic acid hydrazide | 2A-101446 | 2A-9001446 |
| 2-(Bromomethyl)-1,1,1,3,3,3-hexafluoropropane | 382-14-9 | 2A-9001450 |
| 2-(Bromomethyl)benzeneboronic acid | 91983-14-1 | 2A-9001452 |
| 2-(Bromomethyl)benzeneboronic acid pinacol ester | 377780-72-8 | 2A-9001453 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA