
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55579-71-0 |
| Catalog No. | 2A-0141815 |
| Chinese Name | 5-(3-氯苯基)环己烷-1,3-二酮 |
| Synonyms | hms563i13 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.66800 |
| Purity | 96+ |
| Density | 1.268g/cm3 |
| Boiling Point | 383.3ºC at 760 mmHg |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| SMILES | O=C1CC(=O)CC(c2cccc(Cl)c2)C1 |
| InChI Key | YSNSALYPQQBIDC-UHFFFAOYSA-N |
| MSDS | msds/141815_1_55579_71_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 4-METHOXY-3-METHYLPHENYLACETONE | 16882-23-8 | 2A-0140235 |
| 4-OXO-CYCLOHEXANECARBONITRILE | 34916-10-4 | 2A-0140910 |
| 4-OXOCYCLOHEXANECARBOXAMIDE | 204136-88-9 | 2A-0140914 |
| 5,5-DIMETHYL-2-(PROPAN-2-YLIDENE)CYCLOHEXANE-1,3-DIONE | 122772-35-4 | 2A-0141237 |
| 5-(2-FLUOROPHENYL)CYCLOHEXANE-1,3-DIONE | 102821-72-7 | 2A-0141724 |
| 5-ISOPROPYLCYCLOHEXANE-1,3-DIONE | 18456-87-6 | 2A-0145323 |
| 5-METHYLHEXANE-2,3-DIONE | 13706-86-0 | 2A-0145703 |
| 5-PYRIDIN-2-YLCYCLOHEXANE-1,3-DIONE | 144128-79-0 | 2A-0146011 |
| 5-PYRIDIN-4-YLCYCLOHEXANE-1,3-DIONE | 75618-39-2 | 2A-0146015 |
| 6-BROMO-2-NAPHTHYLMETHANOL | 100751-63-1 | 2A-0147046 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA