
CAS Number3213-30-7
Synonyms4-methoxytyramine; 4-O-Methyldopamine; 4-methoxy-3-hydroxyphenethylamine; 4-Methoxy-3-hydroxyphenethylamine hydrochloride; para-Methoxydopamine; 2-<3-hydroxy-4-methoxyphenyl>ethylamine; 2-3'-hydroxy-4'-methoxyphenethylamine; 3-hydroxy-4-methoxyphenethylamine; Lopac-H-3132
Molecular FormulaC9H13NO2
Molecular Weight167.21
Purity96+%
Density1.127g/cm3
Boiling Point306.8ºC at 760mmHg
Melting Point151-153°C (lit.)
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3213-30-7 |
| Catalog No. | 2A-0141686 |
| Chinese Name | 5-(2-氨基乙基)-2-甲氧基苯酚 |
| Synonyms | 4-methoxytyramine; 4-O-Methyldopamine; 4-methoxy-3-hydroxyphenethylamine; 4-Methoxy-3-hydroxyphenethylamine hydrochloride; para-Methoxydopamine; 2-<3-hydroxy-4-methoxyphenyl>ethylamine; 2-3'-hydroxy-4'-methoxyphenethylamine; 3-hydroxy-4-methoxyphenethylamine; Lopac-H-3132 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 |
| Purity | 96+ |
| Density | 1.127g/cm3 |
| Boiling Point | 306.8ºC at 760mmHg |
| Melting Point | 151-153°C (lit.) |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| SMILES | COc1ccc(CCN)cc1O |
| InChI | InChI=1S/C9H13NO2/c1-12-9-3-2-7(4-5-10)6-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
| InChI Key | WJXQFVMTIGJBFX-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/141686_1_3213_30_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-(2-(DIETHYLAMINO)ETHYL)-1,3,4-THIADIAZOL-2-AMINE | 14068-40-7 | 2A-0141679 |
| 5-(2-(METHYLTHIO)PHENYL)NICOTINIC ACID | 1261964-02-6 | 2A-0141680 |
| 5-(2-(PYRROLIDIN-1-YL)ETHYLTHIO)THIAZOL-2-AMINE | 1042777-99-0 | 2A-0141681 |
| 5-(2-AMINOETHYL)-1,3,4-THIADIAZOL-2-AMINE | 74784-47-7 | 2A-0141683 |
| 5-(2-AMINOETHYL)-1-(2-METHOXYETHYL)PYRROLIDIN-2-ONE | 1263095-67-5 | 2A-0141684 |
| 5-(2-AMINOETHYL)-6-HYDROXY-1-METHYLPYRIMIDIN-2(1H)-ONE | 1142201-84-0 | 2A-0141687 |
| 5-(2-AMINOETHYL)THIAZOL-2-AMINE DIHYDROCHLORIDE | 105774-05-8 | 2A-0141689 |
| 5-(2-BROMOETHOXY)-2,3-DIHYDROBENZO[B][1,4]DIOXINE | 1710-62-9 | 2A-0141692 |
| 5-(2-BROMOPROPYL)BENZO[D][1,3]DIOXOLE | 5463-71-8 | 2A-0141701 |
| 5-(2-BROMOVINYL)BENZO[D][1,3]DIOXOLE | 17207-73-7 | 2A-0141702 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA