
CAS Number13928-68-2
Synonyms1,3-Me2-5,7-Ad(COOH)2; 1,3-dimethyladamantane-5,7-dicarboxylic acid; (1s,3s,5s,7s)-5,7-Dimethyl-1,3-adamantanedicarboxylic acid; 5,7-dimethyl-1,3-adamantane dicarboxylic acid; 1.3-Dimethyladamantan-5.7-dicarbonsaeure; 1,3-Dimethyl-5,7-adamantanedicarboxylic acid
Molecular FormulaC14H20O4
Molecular Weight252.31
Purity96+%
Density1.4±0.1 g/cm3
Boiling Point371.4±15.0 °C at 760 mmHg
Appearancesolid
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13928-68-2 |
| Catalog No. | 2A-0141538 |
| Chinese Name | 5,7-二甲基金刚烷-1,3-二羧酸 |
| Synonyms | 1,3-Me2-5,7-Ad(COOH)2; 1,3-dimethyladamantane-5,7-dicarboxylic acid; (1s,3s,5s,7s)-5,7-Dimethyl-1,3-adamantanedicarboxylic acid; 5,7-dimethyl-1,3-adamantane dicarboxylic acid; 1.3-Dimethyladamantan-5.7-dicarbonsaeure; 1,3-Dimethyl-5,7-adamantanedicarboxylic acid |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 371.4±15.0 °C at 760 mmHg |
| Appearance | solid |
| EINECS | 0 |
| HTC | 2917209090 |
| UN(IATA) | 0 |
| PubChem ID | 329792399 |
| MDL Number | MFCD01825788 |
| SMILES | C[C@]12C[C@]3(C)C[C@](C1)(C[C@](C2)(C3)C(O)=O)C(O)=O |
| InChI | 1S/C14H20O4/c1-11-3-12(2)6-13(4-11,9(15)16)8-14(5-11,7-12)10(17)18/h3-8H2,1-2H3,(H,15,16)(H,17,18)/t11-,12+,13+,14- |
| InChI Key | KGFHKUZOSKDAKW-LVEBTZEWSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/141538_1_13928_68_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 5,5'-OXYBIS(3-(TRIFLUOROMETHYL)ANILINE) | 133532-74-8 | 2A-0141220 |
| 5,5,8,8-TETRAMETHYL-5,6,7,8-TETRAHYDRONAPHTHALENE-2-CARBOXYLIC ACID | 103031-30-7 | 2A-0141225 |
| 5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[B]THIOPHENE-2-CARBOHYDRAZIDE | 588696-80-4 | 2A-0141276 |
| 5,6-DIMETHOXYNICOTINALDEHYDE | 52605-99-9 | 2A-0141431 |
| 5,6-DIMETHOXYPICOLINALDEHYDE | 106331-68-4 | 2A-0141433 |
| 5,8-DIAZASPIRO[3.5]NONANE | 90566-57-7 | 2A-0141545 |
| 5-(1,2-DIHYDROXY-2-(PYRIDIN-4-YL)ETHYL)-2,3-DIHYDRO-1H-INDEN-1-ONE O-METHYL OXIME | 405554-64-5 | 2A-0141610 |
| 5-(2,6-DIMETHOXYPHENYL)NICOTINALDEHYDE | 887973-87-7 | 2A-0141670 |
| 5-(2-(TRIFLUOROMETHYL)PHENYL)PICOLINIC ACID | 1158763-52-0 | 2A-0141682 |
| 5-(2-CHLOROPHENYL)NICOTINALDEHYDE | 855301-00-7 | 2A-0141715 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA