
CAS Number16303-58-5
Synonyms5,5'-Dimethyl-2,2'-bithiophenyl; MFCD01927313; 5,5'-Dimethyl-2,2'-bithiophene; 5,5'-Dimethyl-2,2'-bithiophene; 5,5'-dimethyl-2,2'-bisthiophene
Molecular FormulaC10H10S2
Molecular Weight194.319
Purity96+%
Density1.2±0.1 g/cm3
Boiling Point262.9±35.0 °C at 760 mmHg
Melting Point64ºC
AppearanceYellow to light brown crystals
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16303-58-5 |
| Catalog No. | 2A-0141217 |
| Chinese Name | 5,5-二甲基-2,2-并噻吩 |
| Synonyms | 5,5'-Dimethyl-2,2'-bithiophenyl; MFCD01927313; 5,5'-Dimethyl-2,2'-bithiophene; 5,5'-Dimethyl-2,2'-bithiophene; 5,5'-dimethyl-2,2'-bisthiophene |
| Molecular Formula | C10H10S2 |
| Molecular Weight | 194.319 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 262.9±35.0 °C at 760 mmHg |
| Melting Point | 64ºC |
| Appearance | Yellow to light brown crystals |
| Storage Condition | Sealed in a cool, dry environment |
| EINECS | 0 |
| HTC | 2934999090 |
| UN(IATA) | 0 |
| MDL Number | MFCD01927313 |
| SMILES | Cc1ccc(-c2ccc(C)s2)s1 |
| InChI | InChI=1S/C10H10S2/c1-7-3-5-9(11-7)10-6-4-8(2)12-10/h3-6H,1-2H3 |
| InChI Key | DKHDQTBBXQMFPP-UHFFFAOYSA-N |
| MSDS | msds/141217_1_16303_58_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4H-BENZO[4,5]IMIDAZO[1,2-B]PYRAZOLE-3-CARBONITRILE | 64096-91-9 | 2A-0141163 |
| 4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE | 23443-10-9 | 2A-0141168 |
| 4H-PYRROLO[3,2,1-IJ]QUINOLIN-6(5H)-ONE | 603310-86-7 | 2A-0141170 |
| 4H-THIENO[3,2-B]PYRROLE-5-CARBOXYLIC ACID | 39793-31-2 | 2A-0141172 |
| 5,5'-DIBROMO-2,2'-BIPYRIDINE | 15862-18-7 | 2A-1141212 |
| 5,5-BIS(BROMOMETHYL)-2,2-DIMETHYL-1,3-DIOXANE | 43153-20-4 | 2A-0141227 |
| 5,5-DIFLUORO-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE | 1031926-89-2 | 2A-0141230 |
| 5,6,7,8-TETRAHYDRO-10H-PYRIDO[1,2-A]THIENO[3,2-D]PYRIMIDIN-10-ONE | 120079-42-7 | 2A-0141269 |
| 5,6,7,8-TETRAHYDRO-4H-CYCLOHEPTA[D]ISOXAZOLE-3-CARBOXYLIC ACID | 33230-32-9 | 2A-0141277 |
| 5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDIN-4(3H)-ONE | 859826-41-8 | 2A-0141305 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA