CAS Number103-23-1
SynonymsBis(2-ethylhexyl)adipat; Dioctyl Adipate; DEHA; Adipic Acid Dioctyl Ester; Adipic acid di(2-ethylhexyl) ester; Bis(2-ethylhexyl)adipate; Hexanedioic acid, bis(2-ethylhexyl) ester; EINECS 203-090-1; Di(2-ethylhexyl)adipate; di-(2-Ethylhexyl) adipate; Bis(2-ethylhexyl) adipate; Di(2-ethylhexyl) Adipate; bis(2-ethylhexyl) hexanedioate; MFCD03095692; Adipic acid, bis(2-ethylhexyl) ester
Molecular Formula[-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2
Molecular Weight370.57
Purity99%
Density0.9±0.1 g/cm3
Boiling Point175 °C/2 mmHg (lit.)
Melting Point<−70 °C (lit.)
AppearanceColorless or light yellow oily liquid with special smell
EINECS203-090-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 103-23-1 |
| Catalog No. | 2A-9013841 |
| Chinese Name | 己二酸二异辛酯 |
| Synonyms | Bis(2-ethylhexyl)adipat; Dioctyl Adipate; DEHA; Adipic Acid Dioctyl Ester; Adipic acid di(2-ethylhexyl) ester; Bis(2-ethylhexyl)adipate; Hexanedioic acid, bis(2-ethylhexyl) ester; EINECS 203-090-1; Di(2-ethylhexyl)adipate; di-(2-Ethylhexyl) adipate; Bis(2-ethylhexyl) adipate; Di(2-ethylhexyl) Adipate; bis(2-ethylhexyl) hexanedioate; MFCD03095692; Adipic acid, bis(2-ethylhexyl) ester |
| Molecular Formula | [-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2 |
| Molecular Weight | 370.57 |
| Purity | 99 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 175 °C/2 mmHg (lit.) |
| Melting Point | <−70 °C (lit.) |
| Appearance | Colorless or light yellow oily liquid with special smell |
| Water Solubility | immiscible |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| EINECS | 203-090-1 |
| HTC | 29171290 |
| PubChem ID | 24874479 |
| MDL Number | MFCD00009496 |
| SMILES | CCCCC(CC)COC(=O)CCCCC(=O)OCC(CC)CCCC |
| InChI | 1S/C22H42O4/c1-5-9-13-19(7-3)17-25-21(23)15-11-12-16-22(24)26-18-20(8-4)14-10-6-2/h19-20H,5-18H2,1-4H3 |
| InChI Key | SAOKZLXYCUGLFA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1803774 |
| NACRES Code | NB.61 |
| UNSPSC | 26111700 |
| MSDS | msds/13841_1_103_23_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Beryllium nitrate | 13597-99-4 | 2A-9013836 |
| Beryllium oxide hydrate | 21883-51-2 | 2A-9013837 |
| Beryllium oxyfluoride | 63990-88-5 | 2A-9013838 |
| Beryllium phosphate | 13598-15-7 | 2A-9013839 |
| Beryllium sulfate | 7787-56-6 | 2A-9013840 |
| Bis(2-ethylhexyl) phosphate | 298-07-7 | 2A-9013842 |
| Bis(4-Methylphenyl)iodonium hexafluorophosphate | 60565-88-0 | 2A-9013843 |
| Bismuth | 7440-69-9 | 2A-9013847 |
| Bismuth (III) hydroxide | 10361-43-0 | 2A-9013848 |
| Bismuth borate | 37233-77-5 | 2A-9013849 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS