
CAS Number142994-09-0
Synonyms4-Chloro-2-(trifluoromethyl)benzoic acid; 4-Chloro-α,α,α-trifluoro-o-toluic acid; QVR DG BXFFF; 4-chloro-2-trifluoromethylbenzoic acid; MFCD01631353
Molecular FormulaC8H4ClF3O2
Molecular Weight224.564
Purity96+%
Density1.5±0.1 g/cm3
Boiling Point264.7±40.0 °C at 760 mmHg
Melting Point110 °C
AppearanceSolid;White to Light yellow powder to crystal
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 142994-09-0 |
| Catalog No. | 2A-0138360 |
| Chinese Name | 4-氯-2-(三氟甲基)苯甲酸 |
| Synonyms | 4-Chloro-2-(trifluoromethyl)benzoic acid; 4-Chloro-α,α,α-trifluoro-o-toluic acid; QVR DG BXFFF; 4-chloro-2-trifluoromethylbenzoic acid; MFCD01631353 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Purity | 96+ |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 264.7±40.0 °C at 760 mmHg |
| Melting Point | 110 °C |
| Appearance | Solid;White to Light yellow powder to crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 0 |
| HTC | 2916399090 |
| UN(IATA) | 0 |
| SMILES | O=C(O)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3O2/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H,13,14) |
| InChI Key | RKZXXMAQKMOZLK-UHFFFAOYSA-N |
| MSDS | msds/138360_1_142994_09_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-CARBOXYBENZENESULFONYLAZIDE | 17202-49-2 | 2A-1138154 |
| 4-CHLORO-1-(CHLOROMETHYL)-2-METHYLBENZENE | 16470-09-0 | 2A-0138187 |
| 4-CHLORO-1-ETHYNYL-2-(TRIFLUOROMETHYL)BENZENE | 1231244-86-2 | 2A-0138192 |
| 4-CHLORO-2,5-DIFLUOROBENZALDEHYDE | 879093-02-4 | 2A-0138264 |
| 4-CHLORO-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE | 1073371-77-3 | 2A-0138311 |
| 4-CHLORO-2-FLUORO-5-METHOXYBENZALDEHYDE | 177034-24-1 | 2A-0138395 |
| 4-CHLORO-2-METHOXYNICOTINALDEHYDE | 1008451-58-8 | 2A-0138445 |
| 4-CHLORO-2-METHYL-1-(TRIFLUOROMETHYL)BENZENE | 13630-22-3 | 2A-0138450 |
| 4-CHLORO-3,5-DIMETHYLBENZALDEHYDE | 51719-64-3 | 2A-0138517 |
| 4-CHLORO-3-(TRIFLUOROMETHYL)BENZAMIDE | 62584-23-0 | 2A-0138537 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA