
CAS Number40877-09-6
SynonymsMFCD00018993; 4,4'-DICHLOROBUTYROPHENONE; EINECS 255-123-4; 4-Chloro-1-(4-chlorophenyl)-1-butanone; 4-chloro-1-(4-chlorophenyl)butan-1-one; 4,4′-Dichlorobutyrophenone
Molecular FormulaC10H10O1Cl2
Molecular Weight217.09
Purity96+%
Density1.2±0.1 g/cm3
Boiling Point333.8±22.0 °C at 760 mmHg
Melting Point29-30 °C
AppearanceClear yellow to brown liquid after melting point
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40877-09-6 |
| Catalog No. | 2A-0138185 |
| Chinese Name | 4,4'-二氯苯丁酮 |
| Synonyms | MFCD00018993; 4,4'-DICHLOROBUTYROPHENONE; EINECS 255-123-4; 4-Chloro-1-(4-chlorophenyl)-1-butanone; 4-chloro-1-(4-chlorophenyl)butan-1-one; 4,4′-Dichlorobutyrophenone |
| Molecular Formula | C10H10O1Cl2 |
| Molecular Weight | 217.09 |
| Purity | 96+ |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 333.8±22.0 °C at 760 mmHg |
| Melting Point | 29-30 °C |
| Appearance | Clear yellow to brown liquid after melting point |
| Storage Condition | Sealed, cool and dry storage |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00018993 |
| SMILES | O=C(CCCCl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H10Cl2O/c11-7-1-2-10(13)8-3-5-9(12)6-4-8/h3-6H,1-2,7H2 |
| InChI Key | UKCHLVFIVJBCKE-UHFFFAOYSA-N |
| MSDS | msds/138185_1_40877_09_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-BROMOQUINOLIN-8-OL | 139399-63-6 | 2A-0138104 |
| 4-BUTOXY-2,3-DIFLUOROPHENOL | 136239-68-4 | 2A-0138121 |
| 4-BUTYL-N,N-DIMETHYLANILINE | 13330-29-5 | 2A-0138135 |
| 4-CHLORO-1,2-DIHYDRO-3H-INDAZOL-3-ONE | 787580-87-4 | 2A-0138167 |
| 4-CHLORO-1,5-NAPHTHYRIDIN-3-AMINE | 930276-73-6 | 2A-0138177 |
| 4-CHLORO-1-IODO-2-METHOXYBENZENE | 755027-21-5 | 2A-0138195 |
| 4-CHLORO-1-IODO-2-NITROBENZENE | 5446-05-9 | 2A-0138196 |
| 4-CHLORO-1-MORPHOLINOBUTAN-1-ONE | 69966-83-2 | 2A-0138214 |
| 4-CHLORO-1-NAPHTHOIC ACID | 1013-04-3 | 2A-0138215 |
| 4-CHLORO-1A,2,3,7B-TETRAHYDRONAPHTHO[1,2-B]OXIRENE | 116383-67-6 | 2A-0138220 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA