
CAS Number13991-36-1
Synonyms4-BroMobut-2-enoic acid; 2-Butenoic acid,4-bromo-,(E); (2E)-4-bromobut-2-enoic acid; trans-4-Bromo-2-butenoic Acid; 4-Bromocrotonic Acid; bromocrotonic acid; (2E)-4-Bromo-2-butenoic acid; (E)-4-bromocrotonic acid; 4-bromo crotonic acid; (E)-4-Bromo-2-butenoic acid
Molecular FormulaC4H5O2Br1
Molecular Weight164.99
Purity96+%
Density1.7±0.1 g/cm3
Boiling Point287.6±23.0 °C at 760 mmHg
Melting Point74ºC
Appearancewhite to red yellow crystal powder
EINECS0
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13991-36-1 |
| Catalog No. | 2A-0138020 |
| Chinese Name | 4-溴代巴豆酸 |
| Synonyms | 4-BroMobut-2-enoic acid; 2-Butenoic acid,4-bromo-,(E); (2E)-4-bromobut-2-enoic acid; trans-4-Bromo-2-butenoic Acid; 4-Bromocrotonic Acid; bromocrotonic acid; (2E)-4-Bromo-2-butenoic acid; (E)-4-bromocrotonic acid; 4-bromo crotonic acid; (E)-4-Bromo-2-butenoic acid |
| Molecular Formula | C4H5O2Br1 |
| Molecular Weight | 164.99 |
| Purity | 96+ |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 287.6±23.0 °C at 760 mmHg |
| Melting Point | 74ºC |
| Appearance | white to red yellow crystal powder |
| Storage Condition | Refrigerator |
| Packaging | III |
| EINECS | 0 |
| HTC | 2916190090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00082701 |
| SMILES | O=C(O)C=CCBr |
| InChI | InChI=1S/C4H5BrO2/c5-3-1-2-4(6)7/h1-2H,3H2,(H,6,7)/b2-1+ |
| InChI Key | DOTGZROJTAUYFQ-OWOJBTEDSA-N |
| Hazard Symbols | Category 8 |
| MSDS | msds/138020_1_13991_36_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-BROMO-N-PROPYLBENZENESULFONAMIDE | 3476-19-5 | 2A-0137979 |
| 4-BROMO-N-PROPYLPYRIDIN-2-AMINE | 1280786-74-4 | 2A-0137980 |
| 4-BROMO-N1,N1-DIMETHYLBENZENE-1,2-DIAMINE | 183251-89-0 | 2A-0137982 |
| 4-BROMO-P-TERPHENYL | 1762-84-1 | 2A-0137988 |
| 4-BROMOBENZO[D]ISOXAZOL-3-AMINE | 796969-15-8 | 2A-0138005 |
| 4-BROMOBUTAN-1-AMINE HYDROBROMIDE | 24566-81-2 | 2A-0138021 |
| 4-BROMOCYCLOHEX-1-ENE | 3540-84-9 | 2A-0138023 |
| 4-BROMODIHYDROTHIOPHEN-3(2H)-ONE 1,1-DIOXIDE | 143654-18-6 | 2A-0138026 |
| 4-BROMOISOQUINOLIN-3-AMINE | 10321-49-0 | 2A-1138041 |
| 4-BROMOISOQUINOLIN-3-OL | 36963-50-5 | 2A-1138042 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA