
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 162258-89-1 |
| Catalog No. | 2A-0137756 |
| Chinese Name | 4-溴-4'-叔丁基联苯 |
| Synonyms | 4-Bromo-4′-tert-butylbiphenyl; 1-bromo-4-(4-tert-butylphenyl)benzene |
| Molecular Formula | C16H17Br |
| Molecular Weight | 289.21000 |
| Purity | 96+ |
| Density | 1.217g/cm3 |
| Boiling Point | 152ºC/2mm |
| Melting Point | 143ºC |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| EINECS | 0 |
| HTC | 2903999090 |
| UN(IATA) | 0 |
| SMILES | CC(C)(C)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI Key | QYNWFBYWVPMMRL-UHFFFAOYSA-N |
| MSDS | msds/137756_1_162258_89_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-BROMO-3-METHYLACETOPHENONE | 37074-40-1 | 2A-0137718 |
| 4-BROMO-3-METHYLPYRIDIN-2-AMINE | 861024-02-4 | 2A-1137729 |
| 4-BROMO-3-NITROBENZAMIDE | 879-93-6 | 2A-0137735 |
| 4-BROMO-4'-IODO-1,1'-BIPHENYL | 105946-82-5 | 2A-0137752 |
| 4-BROMO-4'-NITRO-1,1'-BIPHENYL | 6242-98-4 | 2A-0137753 |
| 4-BROMO-5-ETHOXY-2-NITRO-N-PROPYLANILINE | 1280786-62-0 | 2A-0137770 |
| 4-BROMO-5-ETHOXY-2-NITROANILINE | 1242336-59-9 | 2A-0137771 |
| 4-BROMO-5-ETHOXY-N-ETHYL-2-NITROANILINE | 1280786-88-0 | 2A-0137772 |
| 4-BROMO-5-ETHOXY-N-ISOPROPYL-2-NITROANILINE | 1330750-39-4 | 2A-0137773 |
| 4-BROMO-5-FLUORO-2-METHOXYANILINE | 330794-03-1 | 2A-0137779 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA