
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4578-63-6 |
| Catalog No. | 2A-0136210 |
| Chinese Name | 4-叔丁基-2-羟基苯甲酸 |
| Synonyms | 4-tert-butyl-2-hydroxybenzoic acid |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.22700 |
| Purity | 96+ |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2918290000 |
| UN(IATA) | 0 |
| SMILES | CC(C)(C)c1ccc(C(=O)O)c(O)c1 |
| InChI Key | DEZCCOKUEFEDGQ-UHFFFAOYSA-N |
| MSDS | msds/136210_1_4578_63_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(TERT-BUTOXY)-N-METHOXY-N-METHYLBENZAMIDE | 916791-35-0 | 2A-0136179 |
| 4-(TERT-BUTOXY)ANILINE | 57120-36-2 | 2A-0136180 |
| 4-(TERT-BUTOXYMETHYL)TETRAHYDRO-2H-PYRAN-4-AMINE | 951625-96-0 | 2A-0136204 |
| 4-(TERT-BUTYL)-1,1'-BIPHENYL | 1625-92-9 | 2A-0136205 |
| 4-(TERT-BUTYL)-2,6-BIS(METHOXYMETHYL)PHENOL | 421546-91-0 | 2A-0136206 |
| 4-(TERT-BUTYL)-2-HYDROXYBENZONITRILE | 145818-28-6 | 2A-0136211 |
| 4-(TERT-BUTYL)-3-IODOBENZOIC ACID | 91131-72-5 | 2A-2136213 |
| 4-(TERT-BUTYL)-4'-NITRO-1,1'-BIPHENYL | 279242-11-4 | 2A-0136214 |
| 4-(TERT-BUTYL)-6-HYDRAZINYL-1,3,5-TRIAZIN-2-AMINE | 175204-78-1 | 2A-0136215 |
| 4-(TERT-BUTYL)-6-METHOXY-1,3,5-TRIAZIN-2-AMINE | 175204-54-3 | 2A-0136216 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA