
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26697-35-8 |
| Catalog No. | 2A-0135601 |
| Chinese Name | 4-(苄氧基)-2-硝基苯胺 |
| Synonyms | 2-nitro-4-phenylmethoxyaniline |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.252 |
| Purity | 96+ |
| Density | 1.297g/cm3 |
| Boiling Point | 443.6ºC at 760 mmHg |
| Melting Point | 141-143ºC |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2922199090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00024263 |
| SMILES | Nc1ccc(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O3/c14-12-7-6-11(8-13(12)15(16)17)18-9-10-4-2-1-3-5-10/h1-8H,9,14H2 |
| InChI Key | JGVXQZRIRQLMHA-UHFFFAOYSA-N |
| MSDS | msds/135601_1_26697_35_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(BENZYLOXY)-2,3-DIHYDRO-1H-INDEN-1-ONE | 86045-82-1 | 2A-0135588 |
| 4-(BENZYLOXY)-2-FLUORO-1-METHYLBENZENE | 1036724-56-7 | 2A-0135595 |
| 4-(BENZYLOXY)-2-FLUORO-1-NITROBENZENE | 221040-07-9 | 2A-0135596 |
| 4-(BENZYLOXY)-2-FLUOROBENZOIC ACID | 114045-96-4 | 2A-0135598 |
| 4-(BENZYLOXY)-2-METHYLBENZOIC ACID | 17819-91-9 | 2A-0135600 |
| 4-(BENZYLOXY)-3-BROMO-5-FLUOROANILINE | 1215206-01-1 | 2A-0135605 |
| 4-(BENZYLOXY)-3-CHLOROPHENOL | 86902-27-4 | 2A-0135607 |
| 4-(BENZYLOXY)-3-FLUOROPHENOL | 81228-25-3 | 2A-0135609 |
| 4-(BENZYLOXY)-3-METHOXYANILINE HYDROCHLORIDE | 1159825-08-7 | 2A-0135612 |
| 4-(BENZYLOXY)-3-METHYLANILINE HYDROCHLORIDE | 1150114-24-1 | 2A-0135613 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA