
CAS Number108-11-2
SynonymsFEMA 3351; 3-HEXYL ALCOHOL; EINECS 210-790-0; dimethyl 2-butanol; 4-Methyl-2-pentanol; (±)-4-Methyl-2-pentanol; DL-3-HEXANOL; Metilamil alcohol; MAOH; Methyl isobutyl carbinol (MIBC); sec-Hexyl Alcohol; 1-Ethylbutanol; 4-Methylpentan-2-ol; 3-MIC,Isobutyl methyl carbinol,MAOH; methyl-isobutyl-carbinol; 2-methyl-4-pentanol; 3-MIC; 1,3-Dimethyl butanol; Methyl Isobutyl Carbinol; MFCD00004550; 1,3-dimethylbutanol; Methylisobutylcarbinol; Methyl-2-pentanol; isobutylmethylcarbinol; UNII:8U34XJK0R0; MIBC; 4-methyl-2pentanol
Molecular Formula(CH3)2CHCH2CH(OH)CH3
Molecular Weight102.17
Purity98%
Density0.8±0.1 g/cm3
Boiling Point132 °C (lit.)
Melting Point−90 °C (lit.)
AppearanceA clear, colorless liquid with a mild odor
EINECS203-551-7
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108-11-2 |
| Catalog No. | 2A-9013541 |
| Chinese Name | 甲基异丁基甲醇(MIBC) |
| Synonyms | FEMA 3351; 3-HEXYL ALCOHOL; EINECS 210-790-0; dimethyl 2-butanol; 4-Methyl-2-pentanol; (±)-4-Methyl-2-pentanol; DL-3-HEXANOL; Metilamil alcohol; MAOH; Methyl isobutyl carbinol (MIBC); sec-Hexyl Alcohol; 1-Ethylbutanol; 4-Methylpentan-2-ol; 3-MIC,Isobutyl methyl carbinol,MAOH; methyl-isobutyl-carbinol; 2-methyl-4-pentanol; 3-MIC; 1,3-Dimethyl butanol; Methyl Isobutyl Carbinol; MFCD00004550; 1,3-dimethylbutanol; Methylisobutylcarbinol; Methyl-2-pentanol; isobutylmethylcarbinol; UNII:8U34XJK0R0; MIBC; 4-methyl-2pentanol |
| Molecular Formula | (CH3)2CHCH2CH(OH)CH3 |
| Molecular Weight | 102.17 |
| Purity | 98 |
| Density | 0.8±0.1 g/cm3 |
| Boiling Point | 132 °C (lit.) |
| Melting Point | −90 °C (lit.) |
| Appearance | A clear, colorless liquid with a mild odor |
| Water Solubility | 2 g/100 mL |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| Packaging | III |
| EINECS | 203-551-7 |
| HTC | 29051900 |
| UN(IATA) | 2053 |
| PubChem ID | 24846945 |
| MDL Number | MFCD00004550 |
| SMILES | CC(C)CC(C)O |
| InChI | 1S/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3 |
| InChI Key | WVYWICLMDOOCFB-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1098268 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 3 |
| MSDS | msds/13541_1_108_11_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2905199090. saturated monohydric alcohols. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Hydroxypropiophenone | 70-70-2 | 2A-9013530 |
| 4-Methoxyaniline-2,5-disulfonic acid | 83763-33-1 | 2A-9013535 |
| 4-Methoxybenzoic acid | 100-09-4 | 2A-9013536 |
| 4-Methoxybenzyl cyanide | 104-47-2 | 2A-9013537 |
| 4-Methoxythioanisole | 1879-16-9 | 2A-9013539 |
| 4-Methyl-2-pentanone | 108-10-1 | 2A-9013542 |
| 4-Methyl-3-nitrobenzoic acid | 96-98-0 | 2A-9013543 |
| 4'-Methylacetophenone | 122-00-9 | 2A-9013545 |
| 4-Methylaniline | 106-49-0 | 2A-9013546 |
| 4-Methylanisole | 104-93-8 | 2A-9013547 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA