
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 148304-22-7 |
| Catalog No. | 2A-0135270 |
| Chinese Name | 4-(4-甲氧基苯胺)-3-硝基苯甲酸 |
| Synonyms | 4-(4-methoxyanilino)-3-nitrobenzoic acid |
| Molecular Formula | HOC6H3(NO2)CO2H |
| Molecular Weight | 183.12 |
| Purity | 95 |
| Density | 1.414g/cm3 |
| Boiling Point | 474.7ºC at 760 mmHg |
| Melting Point | 229-231 °C (lit.) |
| EINECS | 210-580-9 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 24895657 |
| MDL Number | MFCD00007110 |
| SMILES | OC(=O)c1ccc(c(O)c1)[N+]([O-])=O |
| InChI | 1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChI Key | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2107564 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/135270_1_148304_22_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-FLUOROPHENYL)-5-METHYLTHIAZOL-2-AMINE | 2928-00-9 | 2A-0135240 |
| 4-(4-FLUOROPHENYL)-6-METHYLPYRIMIDIN-2-AMINE | 133256-49-2 | 2A-0135244 |
| 4-(4-HYDROXYBENZYL)BENZENE-1,2,3-TRIOL | 174462-43-2 | 2A-0135257 |
| 4-(4-ISOPROPYLPHENYL)-5-METHYLTHIAZOL-2-AMINE | 438218-20-3 | 2A-0135267 |
| 4-(4-ISOPROPYLPHENYL)THIAZOL-2-AMINE | 108481-92-1 | 2A-0135268 |
| 4-(4-METHOXYPHENYL)-3-METHYLISOXAZOL-5-AMINE | 902835-79-4 | 2A-0135281 |
| 4-(4-METHOXYPHENYL)-5-METHYLTHIAZOL-2-AMINE | 105512-88-7 | 2A-0135284 |
| 4-(4-METHYLPHENYLSULFONAMIDO)BENZOIC ACID | 37028-85-6 | 2A-0135310 |
| 4-(4-METHYLPIPERAZIN-1-YL)-3-NITROBENZOIC ACID | 137726-00-2 | 2A-0135314 |
| 4-(4-METHYLPIPERAZIN-1-YL)PYRIMIDIN-2-AMINE | 856973-81-4 | 2A-0135328 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA