
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52660-66-9 |
| Catalog No. | 2A-0134491 |
| Chinese Name | 4-(2-氨基乙氧基)苯甲酸 |
| Synonyms | 4-(2-aminoethoxy)benzoic acid dihydrate |
| Molecular Formula | HOC6H4N=NC6H4CO2H |
| Molecular Weight | 242.23 |
| Purity | ≥90 (HPLC) |
| Density | 1.239g/cm3 |
| Boiling Point | 357ºC at 760 mmHg |
| Melting Point | 204-208 °C (lit.) |
| EINECS | 216-655-2 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| PubChem ID | 57654257 |
| MDL Number | MFCD00002428 |
| SMILES | Oc1ccc(cc1)\N=N\c2ccccc2C(O)=O |
| InChI | 1S/C13H10N2O3/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18/h1-8,16H,(H,17,18)/b15-14+ |
| InChI Key | DWQOTEPNRWVUDA-CCEZHUSRSA-N |
| Beilstein/REAXYS | 1842696 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/134491_1_52660_66_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-(PIPERIDIN-1-YL)ETHYL)ANILINE | 168897-21-0 | 2A-0134449 |
| 4-(2-(PIPERIDIN-2-YL)ETHOXY)BENZOIC ACID HYDROCHLORIDE | 89407-98-7 | 2A-0134451 |
| 4-(2-(PYRROLIDIN-1-YL)ETHYL)ANILINE | 168897-20-9 | 2A-0134461 |
| 4-(2-AMINO-5-BROMOPYRIDIN-3-YL)-2-METHYLBUT-3-YN-2-OL | 1262985-25-0 | 2A-0134485 |
| 4-(2-AMINO-5-METHYL-1H-IMIDAZOL-4-YL)PHENOL | 103037-99-6 | 2A-0134487 |
| 4-(2-AMINOETHYL)BENZOIC ACID | 1199-69-5 | 2A-0134499 |
| 4-(2-AMINOETHYL)BENZOIC ACID HYDROCHLORIDE | 60531-36-4 | 2A-0202257 |
| 4-(2-AMINOETHYL)PYRIDIN-2(1H)-ONE DIHYDROBROMIDE | 170026-03-6 | 2A-0134504 |
| 4-(2-AMINOPHENOXY)BENZONITRILE | 30202-92-7 | 2A-0134509 |
| 4-(2-AMINOTHIAZOL-4-YL)BENZOIC ACID | 216959-94-3 | 2A-0134517 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA