
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1763-28-6 |
| Catalog No. | 2A-0133027 |
| Chinese Name | 4,4,4-三氟-3-(三氟甲基)巴豆酸 |
| Synonyms | 4,4,4-trifluoro-3-(trifluoromethyl)but-2-enoic acid; EINECS 217-180-3 |
| Molecular Formula | C5H2O2F6 |
| Molecular Weight | 208.06 |
| Purity | 96+ |
| Density | 1.577g/cm3 |
| Boiling Point | 222.4ºC at 760mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2916190090 |
| UN(IATA) | 0 |
| MDL Number | MFCD00013574 |
| SMILES | O=C(O)C=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H2F6O2/c6-4(7,8)2(1-3(12)13)5(9,10)11/h1H,(H,12,13) |
| InChI Key | ZSBJCNVMTCMOBW-UHFFFAOYSA-N |
| MSDS | msds/133027_1_1763_28_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4,4'-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1,1'-BIPHENYL | 207611-87-8 | 2A-0132972 |
| 4,4'-BIS(BROMOMETHYL)-1,1'-BIPHENYL | 20248-86-6 | 2A-0132973 |
| 4,4'-DIAMINO-[1,1'-BIPHENYL]-2,2'-DICARBOXYLIC ACID | 17557-76-5 | 2A-0132981 |
| 4,4'-DICHLORO-3,3'-BIS(TRIFLUOROMETHYL)-1,1'-BIPHENYL | 372956-43-9 | 2A-0132988 |
| 4,4,4-TRIFLUORO-3,3-BIS(TRIFLUOROMETHYL)BUT-1-ENE | 14115-46-9 | 2A-1133024 |
| 4,4,4-TRIFLUORO-3-(TRIFLUOROMETHYL)BUTANOIC ACID | 17327-33-2 | 2A-0133028 |
| 4,4,5,5-TETRAMETHYL-2-(1,4-DIOXASPIRO[4.5]DEC-7-EN-7-YL)-1,3,2-DIOXABOROLANE | 1049730-46-2 | 2A-0133040 |
| 4,4,5,5-TETRAMETHYL-2-(1-PHENYLETHYL)-1,3,2-DIOXABOROLANE | 174090-36-9 | 2A-0133041 |
| 4,4,5,5-TETRAMETHYL-2-(2-(NAPHTHALEN-2-YL)PHENYL)-1,3,2-DIOXABOROLANE | 1062555-59-2 | 2A-1133045 |
| 4,4,5,5-TETRAMETHYL-2-(2-(TRIFLUOROMETHYL)PHENYL)-1,3,2-DIOXABOROLANE | 1073339-21-5 | 2A-0133048 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA