
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7623-11-2 |
| Catalog No. | 2A-9013291 |
| Chinese Name | 2-氯丁酰氯 |
| Synonyms | MFCD00041409; 2-chlorobutanoyl chloride |
| Molecular Formula | C4H6Cl2O |
| Molecular Weight | 140.99600 |
| Purity | 98.00 |
| Density | 1.236 |
| Boiling Point | 138-140ºC |
| Water Solubility | Reacts with water. |
| Storage Condition | 2-8°C, sealed, filled with inert gas |
| Packaging | II |
| HTC | 2915900090 |
| SMILES | CCC(Cl)C(=O)Cl |
| InChI | InChI=1S/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| InChI Key | KVQJVAOMYWTLEO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloroaniline | 95-51-2 | 2A-9013285 |
| 2-Chloroaniline-5-sulfonic acid | 98-36-2 | 2A-9013286 |
| 2-Chlorobenzonitrile | 873-32-5 | 2A-9013288 |
| 2-Chlorobenzoyl chloride | 609-65-4 | 2A-9013289 |
| 2-Chlorobutane | 78-86-4 | 2A-9013290 |
| 2-Chlorofluorobenzene | 348-51-6 | 2A-9013293 |
| 2-chloro-N,N-dimethylpropan-1-amine hydrochloride | 4584-49-0 | 2A-9013295 |
| 2-Chlorophenylacetic acid | 2444-36-2 | 2A-9013296 |
| 2-Chloropropionic acid ethyl ester | 535-13-7 | 2A-9013297 |
| 2-Cresol | 95-48-7 | 2A-9013300 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA