
CAS Number112-07-2
SynonymsEthanol, 2-butoxy-, acetate; ethylene glycol butyl ether acetate; 1-Acetoxy-2-butoxyethane; GLYCOL MONOBUTYL ETHER ACETATE; EINECS 203-933-3; 2-butoxy-ethanoacetate; Ethylene Glycol Monobutyl Ether Acetate; Acetic Acid 2-Butoxyethyl Ester; 2-butoxyethyl ethanoate; Butoxyethanol acetate; BUTYL GLYCOL ACETATE; Butylglycol acetate; 2-Butoxyethyl acetate; Butylcelosolvacetat; Ethylene glycol mono-n-butyl ether acetate; n-Butoxyethanol acetate; MFCD00009457; 2-butoxyethanolacetate; EB ACETATE; ektasolveebacetate; BUTOXYETHYL ACETATE; acetic acid-(2-butoxy-ethyl ester); 2-Butoxyethanol acetate; 2-(n-butoxy)ethyl acetate; butyl Cellosolve acetate
Molecular FormulaCH3COOCH2CH2O(CH2)3CH3
Molecular Weight160.21
Purity99%
Density0.9±0.1 g/cm3
Boiling Point192 °C (lit.)
Melting Point-63°C
Appearanceliquid
EINECS203-933-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 112-07-2 |
| Catalog No. | 2A-9013274 |
| Chinese Name | 乙二醇丁醚醋酸酯 |
| Synonyms | Ethanol, 2-butoxy-, acetate; ethylene glycol butyl ether acetate; 1-Acetoxy-2-butoxyethane; GLYCOL MONOBUTYL ETHER ACETATE; EINECS 203-933-3; 2-butoxy-ethanoacetate; Ethylene Glycol Monobutyl Ether Acetate; Acetic Acid 2-Butoxyethyl Ester; 2-butoxyethyl ethanoate; Butoxyethanol acetate; BUTYL GLYCOL ACETATE; Butylglycol acetate; 2-Butoxyethyl acetate; Butylcelosolvacetat; Ethylene glycol mono-n-butyl ether acetate; n-Butoxyethanol acetate; MFCD00009457; 2-butoxyethanolacetate; EB ACETATE; ektasolveebacetate; BUTOXYETHYL ACETATE; acetic acid-(2-butoxy-ethyl ester); 2-Butoxyethanol acetate; 2-(n-butoxy)ethyl acetate; butyl Cellosolve acetate |
| Molecular Formula | CH3COOCH2CH2O(CH2)3CH3 |
| Molecular Weight | 160.21 |
| Purity | 99 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 192 °C (lit.) |
| Melting Point | -63°C |
| Appearance | liquid |
| Water Solubility | Water solubility: slightly soluble; water solubili |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| EINECS | 203-933-3 |
| HTC | 2909430000 |
| PubChem ID | 24858580 |
| MDL Number | MFCD00009457 |
| SMILES | CCCCOCCOC(C)=O |
| InChI | 1S/C8H16O3/c1-3-4-5-10-6-7-11-8(2)9/h3-7H2,1-2H3 |
| InChI Key | NQBXSWAWVZHKBZ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1756960 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/13274_1_112_07_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromopentane | 107-81-3 | 2A-0202195 |
| 2-Bromopropane | 75-26-3 | 2A-9013267 |
| 2-Bromopropionyl bromide | 563-76-8 | 2A-9013268 |
| 2-Butanone | 78-93-3 | 2A-9013271 |
| 2-Butene-1,4-diol | 110-64-5 | 2A-9013273 |
| 2-Butyne-1,4-diol | 110-65-6 | 2A-9013275 |
| 2-Chloro-1,1,1-triethoxyethane | 51076-95-0 | 2A-9013276 |
| 2-Chloro-1,1,1-trimethoxyethane | 74974-54-2 | 2A-9013277 |
| 2-chloro-2-methylpropane | 507-20-0 | 2A-9013278 |
| 2-Chloro-4-nitroaniline | 121-87-9 | 2A-9013279 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA