CAS Number112811-68-4
Synonyms2,4,5-Trifluoro-3-Methoxy-B-Oxo-Benzenepropanoic Acid Ethyl Ester; ethyl 3-(2,4,5-trifluoro-3-methoxyphenyl)-3-oxopropanoate; Ethyl 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate; Benzenepropanoic acid, 2,4,5-trifluoro-3-methoxy-β-oxo-, ethyl ester; ethyl 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propionate; 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)-propanoic acid ethyl ester; 3-Oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propionic acid ethyl ester; Benzenepropanoic acid,2,4,5-trifluoro-3-methoxy-b-oxo-,ethyl ester; ethyl 2,4,5-trifluoro-3-methoxybenzoylacetate; 2-(2,4,5-trifluoro-3-methoxybenzoyl)acetic acid ethyl ester; Ethyl 3-methoxy-2,4,5-trifluorobenzoylacetate; 3-oxo-3-(2,4,5-trifluoro-3-methoxy-phenyl)-propionic acid ethyl ester
Molecular FormulaC12H11F3O4
Molecular Weight276.208
Purity96+%
Density1.3±0.1 g/cm3
Boiling Point317.7±37.0 °C at 760 mmHg
Melting Point59-60 °C
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 112811-68-4 |
| Catalog No. | 2A-0132470 |
| Chinese Name | 3-氧代-3(2,4,5-三氟-3-甲氧基苯基)丙酸乙酯 |
| Synonyms | 2,4,5-Trifluoro-3-Methoxy-B-Oxo-Benzenepropanoic Acid Ethyl Ester; ethyl 3-(2,4,5-trifluoro-3-methoxyphenyl)-3-oxopropanoate; Ethyl 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoate; Benzenepropanoic acid, 2,4,5-trifluoro-3-methoxy-β-oxo-, ethyl ester; ethyl 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propionate; 3-oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)-propanoic acid ethyl ester; 3-Oxo-3-(2,4,5-trifluoro-3-methoxyphenyl)propionic acid ethyl ester; Benzenepropanoic acid,2,4,5-trifluoro-3-methoxy-b-oxo-,ethyl ester; ethyl 2,4,5-trifluoro-3-methoxybenzoylacetate; 2-(2,4,5-trifluoro-3-methoxybenzoyl)acetic acid ethyl ester; Ethyl 3-methoxy-2,4,5-trifluorobenzoylacetate; 3-oxo-3-(2,4,5-trifluoro-3-methoxy-phenyl)-propionic acid ethyl ester |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.208 |
| Purity | 96+ |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 317.7±37.0 °C at 760 mmHg |
| Melting Point | 59-60 °C |
| Storage Condition | Room temperature, sealed, dry |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(F)c(OC)c1F |
| InChI Key | WTKWXCRLEWADRT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-CHLORO-2,4-DIFLUORO-6-NITROANILINE | 50408-94-1 | 2A-0130384 |
| 3-FLUORO-2,4-DIMETHOXYANILINE | 195136-66-4 | 2A-0131159 |
| 3-METHYL-2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOTHIOAMIDE | 125187-18-0 | 2A-0132015 |
| 3-METHYLTHIAZOLIDINE-2,4-DIONE | 16312-21-3 | 2A-0132280 |
| 3-OXABICYCLO[3.2.1]OCTANE-2,4-DIONE | 6054-16-6 | 2A-0132448 |
| 4,4'-(6-CHLOROPYRIMIDINE-2,4-DIYL)DIMORPHOLINE | 10244-24-3 | 2A-0132924 |
| 4,4-DIMETHYL-2-(2,4,5-TRIFLUOROPHENYL)-4,5-DIHYDROOXAZOLE | 125290-72-4 | 2A-0133147 |
| 4-((2,4-DIAMINO-5-METHYLPHENYL)IMINO)CYCLOHEXA-2,5-DIENONE | 121-23-3 | 2A-0133758 |
| 4-((2,4-DICHLOROPHENYL)SULFONYL)MORPHOLINE | 74832-72-7 | 2A-0133762 |
| 4-(2,4-DDIMETHOXYBENZYLIDENE)-2-PHENYLOXAZOL-5(4H)-ONE | 118555-99-0 | 2A-0134206 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS