
CAS Number784-77-0
Synonyms4-Chloro-3-(trifluoromethyl)benzamide; 4-Chloro-α,α,α-trifluoro-m-toluamide; ZVR DG CXFFF; 3-Nitro-4-(trifluoromethoxy)benzoicAcid; 3-Nitro-4-trifluormethoxy-benzoesaeure
Molecular FormulaC8H4O3Cl1F3
Molecular Weight240.57
Purity96+%
Density1.5±0.1 g/cm3
Boiling Point258.3±40.0 °C at 760 mmHg
AppearanceWhite to yellow powder or crystal
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 784-77-0 |
| Catalog No. | 2A-0132348 |
| Chinese Name | 3-硝基-4-(三氟甲氧基)苯甲酸 |
| Synonyms | 4-Chloro-3-(trifluoromethyl)benzamide; 4-Chloro-α,α,α-trifluoro-m-toluamide; ZVR DG CXFFF; 3-Nitro-4-(trifluoromethoxy)benzoicAcid; 3-Nitro-4-trifluormethoxy-benzoesaeure |
| Molecular Formula | C8H4O3Cl1F3 |
| Molecular Weight | 240.57 |
| Purity | 96+ |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 258.3±40.0 °C at 760 mmHg |
| Appearance | White to yellow powder or crystal |
| Storage Condition | room temperature |
| EINECS | 0 |
| HTC | 2918990090 |
| UN(IATA) | 0 |
| MDL Number | MFCD01631556 |
| SMILES | O=C(O)c1ccc(OC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI Key | GDBCQTKUSLDFRP-UHFFFAOYSA-N |
| MSDS | msds/132348_1_784_77_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-NITRO-[1,1'-BIPHENYL]-4-AMINE | 4085-18-1 | 2A-0132316 |
| 3-NITRO-1,1'-BIPHENYL | 2113-58-8 | 2A-1132317 |
| 3-NITRO-1,8-NAPHTHYRIDIN-2-OL | 5174-89-0 | 2A-0132319 |
| 3-NITRO-4-(PHENYLAMINO)BENZONITRILE | 16588-23-1 | 2A-0132344 |
| 3-NITRO-4-(PROPYLAMINO)BENZONITRILE | 438554-06-4 | 2A-0132346 |
| 3-NITRO-4-[(3-PYRIDINYLMETHYL)AMINO]BENZOIC ACID | 384855-46-3 | 2A-0132354 |
| 3-NITRO-5,6,7,8-TETRAHYDRONAPHTHALEN-2-OL | 6240-79-5 | 2A-0132366 |
| 3-NITRO-N-PHENYLBENZENESULFONAMIDE | 28791-26-6 | 2A-0132389 |
| 3-NITRO-N-PROPYLBENZAMIDE | 39887-56-4 | 2A-0132391 |
| 3-NITROBENZIMIDAMIDE | 3459-99-2 | 2A-0132400 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA