
CAS Number14073-00-8
Synonyms3-Methyl-4-nitrochinolin-1-oxid; 3-Methyl-4-nitroquinoline 1-oxide; 3-methyl-4-nitroquinoline N-oxide
Molecular FormulaC10H8N2O3
Molecular Weight204.18200
Purity96+%
Density1.36g/cm3
Boiling Point389.6ºC at 760mmHg
Melting Point182 °C
AppearanceSolid;Light yellow to Amber to Dark green powder to crystal
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14073-00-8 |
| Catalog No. | 2A-0132102 |
| Chinese Name | 3-甲基-4-硝基喹啉1-氧化物 |
| Synonyms | 3-Methyl-4-nitrochinolin-1-oxid; 3-Methyl-4-nitroquinoline 1-oxide; 3-methyl-4-nitroquinoline N-oxide |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Purity | 96+ |
| Density | 1.36g/cm3 |
| Boiling Point | 389.6ºC at 760mmHg |
| Melting Point | 182 °C |
| Appearance | Solid;Light yellow to Amber to Dark green powder to crystal |
| Storage Condition | Store in inert gas; avoid light, moisture (hygrosc |
| EINECS | 0 |
| HTC | 2933499090 |
| UN(IATA) | 0 |
| SMILES | Cc1c[n+]([O-])c2ccccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8N2O3/c1-7-6-11(13)9-5-3-2-4-8(9)10(7)12(14)15/h2-6H,1H3 |
| InChI Key | DSDCYTGYMIYMDL-UHFFFAOYSA-N |
| MSDS | msds/132102_1_14073_00_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-METHYL-4,5-DIHYDROISOXAZOLE-5-CARBOXYLIC ACID | 473700-52-6 | 2A-0132063 |
| 3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE | 1032358-00-1 | 2A-0132071 |
| 3-METHYL-4-(PYRROLIDIN-2-YL)PYRIDINE | 23894-37-3 | 2A-0132079 |
| 3-METHYL-4-NITRO-1H-PYRAZOLE-5-CARBOXYLIC ACID | 5334-38-3 | 2A-0132088 |
| 3-METHYL-4-NITROISOXAZOLE-5-CARBALDEHYDE | 6436-64-2 | 2A-0132099 |
| 3-METHYL-4-OXO-4,5,6,7-TETRAHYDROBENZOFURAN-2-CARBOXYLIC ACID | 112579-43-8 | 2A-0132105 |
| 3-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE | 1171891-42-1 | 2A-0132124 |
| 3-METHYL-5-(PYRROLIDIN-3-YL)-1,2,4-OXADIAZOLE HYDROCHLORIDE | 1121057-52-0 | 2A-0132129 |
| 3-METHYL-5-(TRICHLOROMETHYL)-1,2,4-OXADIAZOLE | 1195-25-1 | 2A-0132130 |
| 3-METHYL-5-(TRIFLUOROMETHYL)PYRIDINE | 131748-15-7 | 2A-0132135 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA