
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52218-35-6 |
| Catalog No. | 2A-9013170 |
| Chinese Name | 6-beta-羟乙基砜基-2-萘胺 |
| Synonyms | 6-SS-HYDROXYETHYL SULFONYL-2-NAPHTHALAMINE; 2-Naphthylamine-6-hydroxyethyl sulfonyl; Einecs 257-750-9 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.30200 |
| Purity | 98.00 |
| Density | 1.383 g/cm3 |
| Boiling Point | 566ºC at 760 mmHg |
| Appearance | Light beige powder |
| HTC | 2922199090 |
| SMILES | Nc1ccc2cc(S(=O)(=O)CCO)ccc2c1 |
| InChI | InChI=1S/C12H13NO3S/c13-11-3-1-10-8-12(4-2-9(10)7-11)17(15,16)6-5-14/h1-4,7-8,14H,5-6,13H2 |
| InChI Key | KJADNHVFXWOWKM-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 1,6-Diaminohexane | 124-09-4 | 2A-9013103 |
| 1-Bromohexane | 111-25-1 | 2A-9013131 |
| 2-(2-Aminoethylamino)ethanol | 4439-20-7 | 2A-9013163 |
| 2(2-Ethoxyethoxy)ethanol | 111-90-0 | 2A-0201949 |
| 2-(4-Methylthiazol-5-yl)ethanol | 137-00-8 | 2A-9013169 |
| 2-(Methylamino)ethanol | 109-83-1 | 2A-9013172 |
| 2-Aminophenylethanol | 5339-85-5 | 2A-9013255 |
| 2-Bromo-6-nitrotoluene | 55289-35-5 | 2A-9013260 |
| 2-Bromoethanol | 540-51-2 | 2A-9013265 |
| 2-Bromotoluene | 95-46-5 | 2A-9013270 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA