
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64024-06-2 |
| Catalog No. | 2A-0131369 |
| Chinese Name | 3-氟-D-酪氨酸 |
| Synonyms | (2R)-2-amino-3-(3-fluoro-4-hydroxyphenyl)propanoic acid; D-Tyrosine,3-fluoro; 3-Fluorotyrosine,D; 3-Fluor-D-tyrosin; Tyrosine,3-fluoro-,D; D-3-Fluorotyrosine |
| Molecular Formula | C24H20O5N1F1 |
| Molecular Weight | 421.42 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2922509090 |
| UN(IATA) | 0 |
| MDL Number | MFCD15529899 |
| SMILES | NC(Cc1ccc(O)c(F)c1)C(=O)O |
| InChI | InChI=1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
| InChI Key | VIIAUOZUUGXERI-SSDOTTSWSA-N |
| MSDS | msds/131369_1_64024_06_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-FLUORO-5-METHYLPHENOL | 216976-31-7 | 2A-0131353 |
| 3-FLUORO-5-METHYLPICOLINIC ACID | 1256807-03-0 | 2A-0131354 |
| 3-FLUORO-5-METHYLPYRIDIN-4-AMINE | 13958-85-5 | 2A-2131356 |
| 3-FLUORO-5-NITROPYRIDIN-2-OL | 1033202-14-0 | 2A-0131362 |
| 3-FLUORO-9H-FLUOREN-9-ONE | 1514-15-4 | 2A-0131368 |
| 3-FLUORO-N-((3-PHENYL-1,2,4-OXADIAZOL-5-YL)METHYL)BENZAMIDE | 838867-01-9 | 2A-0131371 |
| 3-FLUORO-N-(3,4,5-TRIFLUOROBENZYL)ANILINE | 637744-49-1 | 2A-0131372 |
| 3-FLUOROCYCLOBUTYL BENZOATE | 1215071-11-6 | 2A-0131388 |
| 3-FLUOROCYCLOPENTANONE | 1215071-10-5 | 2A-0131389 |
| 3-FLUORODIHYDRO-2H-PYRAN-4(3H)-ONE | 624734-19-6 | 2A-0131390 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA