
CAS Number89-69-0
Synonyms1,2,4-Trichloro-5-nitrobenzene; EINECS 201-931-7; MFCD00007072
Molecular FormulaC7H2Cl3NO
Molecular Weight222.459
Purity98.00%
Density1.7±0.1 g/cm3
Boiling Point290.9±35.0 °C at 760 mmHg
Melting Point52-57 °C
AppearanceYellow semi-solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 89-69-0 |
| Catalog No. | 2A-9013044 |
| Chinese Name | 2,4,5-三氯硝基苯 |
| Synonyms | 1,2,4-Trichloro-5-nitrobenzene; EINECS 201-931-7; MFCD00007072 |
| Molecular Formula | C7H2Cl3NO |
| Molecular Weight | 222.459 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 290.9±35.0 °C at 760 mmHg |
| Melting Point | 52-57 °C |
| Appearance | Yellow semi-solid |
| Water Solubility | 27 mg/L (20 ºC) |
| Storage Condition | Store sealed and away from light. |
| Packaging | III |
| HTC | 29392900 |
| MDL Number | MFCD00013844 |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C6H2Cl3NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| InChI Key | IBRBMZRLVYKVRF-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/13044_1_89_69_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2,4,5-Trichloronitrobenzene Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,1-Dichloroethylene | 75-35-4 | 2A-9013034 |
| 1,2,3,5-Tetrachlorobenzene | 634-90-2 | 2A-9013036 |
| 1,2,3-Benzenetriol | 87-66-1 | 2A-9013037 |
| 1,2,3-Trichloropropane | 96-18-4 | 2A-9013040 |
| 1,2,4-Benzenetricarboxylic anhydride | 552-30-7 | 2A-9013041 |
| 1,2,4-Trichlorobenzene | 120-82-1 | 2A-9013045 |
| 1,2,4-Trimethylbenzene | 95-63-6 | 2A-9013046 |
| Ethylenediamine | 107-15-3 | 2A-9013048 |
| 1,2-Dibromoethane | 106-93-4 | 2A-9013049 |
| 1,2-Dichlorobenzene | 95-50-1 | 2A-9013050 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA