
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15253-89-1 |
| Catalog No. | 2A-9001304 |
| Chinese Name | 2-(2,4-二氯苯氧基)丙酸肼 |
| Synonyms | MFCD00204152; 2-(2,4-dichlorophenoxy)propionic acid hydrazide |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.09400 |
| Purity | 98 |
| Density | 1.381 g/cm3 |
| Boiling Point | 444.2ºC at 760 mmHg |
| Melting Point | 164-168 °C |
| Appearance | white powder |
| Storage Condition | Closed at room temperature, protected from light, |
| HTC | 2928000090 |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NN |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-5(9(14)13-12)15-8-3-2-6(10)4-7(8)11/h2-5H,12H2,1H3,(H,13,14)/t5-/m0/s1 |
| InChI Key | ZASHHUFHMQDNNE-UHFFFAOYSA-N |
| MSDS | msds/1304_1_15253_89_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1-Bromo-2,4-difluorobenzene | 348-57-2 | 2A-9001028 |
| 1-Chloro-2,4-dibromo-6-fluorobenzene | 202925-04-0 | 2A-9001102 |
| 1-Chloro-2,4-dinitrobenzene | 97-00-7 | 2A-9001103 |
| 1-Naphthaleneacetic acid methyl ester | 2876-78-0 | 2A-9001241 |
| 2-(2,4-Diamino)benzyloxyethanol dihydrochloride | 66422-95-5 | 2A-9001303 |
| 2-(2,4-Difluorobenzoyl)-3-(dimethylamino)acrylonitrile | 138716-60-6 | 2A-9001305 |
| 2-(2,4-Difluorophenoxy)-3-nitropyridine | 175135-62-3 | 2A-9001306 |
| 2-(2,4-Difluorophenyl)thiazole-4-carboxamide | 175276-97-8 | 2A-9001307 |
| 2,4,5-Tribromoimidazole | 2034-22-2 | 2A-9001751 |
| 2,4,5-Trichloropyrimidine | 5750-76-5 | 2A-9001752 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA