
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 928165-59-7 |
| Catalog No. | 2A-0130361 |
| Chinese Name | 4-辛基-3-氯苯丙酮 |
| Synonyms | x6212; 3-Chloro-1-(4-octylphenyl)-1-propanone |
| Molecular Formula | C7H12ClNOS |
| Molecular Weight | 193.697 |
| Purity | 96+ |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 399.0±35.0 °C at 760 mmHg |
| Appearance | yellow powder |
| Storage Condition | 2-8℃, dry, sealed |
| EINECS | 0 |
| HTC | 2914700090 |
| UN(IATA) | 0 |
| MDL Number | MFCD02666374 |
| SMILES | CCCCCCCCc1ccc(C(=O)CCCl)cc1 |
| InChI Key | RRIVKRLKROHVNQ-UHFFFAOYSA-N |
| MSDS | msds/130361_1_928165_59_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-BUTOXYCYCLOHEX-2-ENONE | 16493-04-2 | 2A-0130332 |
| 3-BUTYL-2-MERCAPTOQUINAZOLIN-4(3H)-ONE | 13906-07-5 | 2A-0130335 |
| 3-BUTYLPYRAZINAMINE | 91678-85-2 | 2A-0130336 |
| 3-CARBOXAMIDOBENZOIC ACID | 4481-28-1 | 2A-1130341 |
| 3-CHLORO-1-(2-FLUOROPHENYL)PROPAN-1-ONE | 898767-04-9 | 2A-0130356 |
| 3-CHLORO-1H-INDAZOL-5-AMINE | 41330-49-8 | 2A-0130368 |
| 3-CHLORO-1H-INDOL-5-AMINE | 525590-26-5 | 2A-0130371 |
| 3-CHLORO-2,6-DIFLUOROPHENOL | 261762-51-0 | 2A-1130397 |
| 3-CHLORO-2,6-DIMETHOXY-5-NITROBENZAMIDE | 175135-58-7 | 2A-0130398 |
| 3-CHLORO-2-(3-METHYLPIPERIDIN-1-YL)ANILINE | 915921-30-1 | 2A-0130412 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA