CAS Number71-55-6
SynonymsTrichloroethane; Methyl Chloroform; methyltrichloromethane; Ethana; MFCD00000806; EINECS 200-756-3; f140a; Trichloromethylmethane; R-140a; 2,2,2-trichloroethane; Chlorothene; methylchloroform; 1,1,1-TCE
Molecular FormulaCl3CCD3
Molecular Weight136.42
Purity99 (CP)%
Density1.4±0.1 g/cm3
Boiling Point74-76 °C (lit.)
Melting Point-35 °C (lit.)
AppearanceColorless liquid with a mild ether-like odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 71-55-6 |
| Catalog No. | 2A-9013030 |
| Chinese Name | 1,1,1-三氯乙烷 |
| Synonyms | Trichloroethane; Methyl Chloroform; methyltrichloromethane; Ethana; MFCD00000806; EINECS 200-756-3; f140a; Trichloromethylmethane; R-140a; 2,2,2-trichloroethane; Chlorothene; methylchloroform; 1,1,1-TCE |
| Molecular Formula | Cl3CCD3 |
| Molecular Weight | 136.42 |
| Purity | 99 (CP) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 74-76 °C (lit.) |
| Melting Point | -35 °C (lit.) |
| Appearance | Colorless liquid with a mild ether-like odor |
| Water Solubility | 1.4 g/L (20 ºc) |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | III |
| HTC | 2903191090 |
| PubChem ID | 329759656 |
| MDL Number | MFCD00142359 |
| SMILES | [2H]C([2H])([2H])C(Cl)(Cl)Cl |
| InChI | 1S/C2H3Cl3/c1-2(3,4)5/h1H3/i1D3 |
| InChI Key | UOCLXMDMGBRAIB-FIBGUPNXSA-N |
| UNSPSC | 12352202 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/13030_1_71_55_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | 1. Import license 4. Export license A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods x. Export license (processing trade) y. Export license (small-scale border |
| Inspection | M.Inspection of imported goods N.Inspection of exported goods |
| Transport Info | Product name: Supervision conditions 1. Import license 4. Export license A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods x. Export license (processing trade) y. Export license (small-scale border trade) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(4-Methoxyphenyl)pentan-1-one | 1671-76-7 | 2A-9013025 |
| 1-(4-Propylphenyl)ethanone | 2932-65-2 | 2A-9013026 |
| 1,1',1 | 122-20-3 | 2A-9013027 |
| 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 2A-9013028 |
| 1,1,1-Tri(hydroxymethyl)propane | 77-99-6 | 2A-9013029 |
| 1,1,1-Trimethoxyethane | 1445-45-0 | 2A-9013031 |
| 1,1,2-Trichloroethane | 79-00-5 | 2A-9013032 |
| 1,1,3,3-Tetramethylguanidine | 80-70-6 | 2A-9013033 |
| 1,1-Dichloroethylene | 75-35-4 | 2A-9013034 |
| 1,2,3,5-Tetrachlorobenzene | 634-90-2 | 2A-9013036 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS