
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35065-86-2 |
| Catalog No. | 2A-0130267 |
| Chinese Name | 3-溴乙酸苯酯 |
| Synonyms | m-BrC6H4OAc; Phenol,3-bromo-,1-acetate; 3-Brom-1-acetoxy-benzol; Phenol,3-bromo-,acetate; 3-BROMO-PHENYL ACETATE |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 215.04400 |
| Purity | 96+ |
| Density | 1.501g/cm3 |
| Boiling Point | 254.9ºC at 760mmHg |
| Storage Condition | room temperature, dry |
| EINECS | 0 |
| HTC | 2915390090 |
| UN(IATA) | 0 |
| SMILES | CC(=O)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrO2/c1-6(10)11-8-4-2-3-7(9)5-8/h2-5H,1H3 |
| InChI Key | CDLTWXBTYNNYLN-UHFFFAOYSA-N |
| MSDS | msds/130267_1_35065_86_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-BROMODIHYDRO-2H-PYRAN-4(3H)-ONE | 98021-79-5 | 2A-0130216 |
| 3-BROMOHEPTAN-4-ONE | 42330-10-9 | 2A-0130223 |
| 3-BROMOOCTANE | 999-64-4 | 2A-0130258 |
| 3-BROMOPERYLENE | 23683-68-3 | 2A-0130260 |
| 3-BROMOPHENANTHRENE-9,10-DIONE | 13292-05-2 | 2A-0130262 |
| 3-BROMOPIPERIDIN-2-ONE | 34433-86-8 | 2A-2130276 |
| 3-BROMOPYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE | 1198569-35-5 | 2A-0130289 |
| 3-BROMOQUINOLIN-2-AMINE | 36825-31-7 | 2A-0130305 |
| 3-BROMOQUINOLIN-5-OL | 123738-15-7 | 2A-0130306 |
| 3-BROMOQUINOLIN-6-OL | 13669-57-3 | 2A-0130307 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA