
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1009093-60-0 |
| Catalog No. | 2A-0129959 |
| Chinese Name | 3-溴-5-氟-2-甲氧基苯甲醛 |
| Molecular Formula | C8H6BrFO2 |
| Molecular Weight | 233.04 |
| Purity | 96+ |
| Boiling Point | 289.8±35.0°C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 141388043 |
| SMILES | COc1c(Br)cc(F)cc1C=O |
| InChI | InChI=1S/C8H6BrFO2/c1-12-8-5(4-11)2-6(10)3-7(8)9/h2-4H,1H3 |
| InChI Key | TXXNMOPCEBWUJN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-BROMO-5-(TRIFLUOROMETHYL)PICOLINALDEHYDE | 1227601-42-4 | 2A-0129907 |
| 3-BROMO-5-(TRIFLUOROMETHYL)PICOLINONITRILE | 760207-85-0 | 2A-0129908 |
| 3-BROMO-5-CHLORO-4-METHOXYBENZALDEHYDE | 161565-36-2 | 2A-0129929 |
| 3-BROMO-5-CYANOBENZALDEHYDE | 644982-55-8 | 2A-1129948 |
| 3-BROMO-5-ETHOXY-4-METHOXYBENZALDEHYDE | 81805-97-2 | 2A-0129953 |
| 3-BROMO-5-FLUORO-4-HYDROXYBENZALDEHYDE | 185345-46-4 | 2A-0129962 |
| 3-BROMO-5-ISOPROPOXYBENZALDEHYDE | 1112210-83-9 | 2A-0129988 |
| 3-BROMO-6-(TRIFLUOROMETHYL)PYRIDIN-2-AMINE | 1214361-39-3 | 2A-0130055 |
| 3-BROMO-6-CHLORO-2-FLUOROBENZALDEHYDE | 886615-30-1 | 2A-0130061 |
| 3-BROMO-6-FLUORO-2-(TRIFLUOROMETHYL)QUINOLIN-4-OL | 1072944-66-1 | 2A-0130084 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA