
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 372120-55-3 |
| Catalog No. | 2A-0129744 |
| Chinese Name | 3-溴-4-三氟甲基苯甲醛 |
| Synonyms | 3-Bromo-4-(trifluoromethyl)benzaldehyde; CL8304; 3-bromo-4-trifluoromethylbenzaldehyde |
| Molecular Formula | C8H4BrF3O |
| Molecular Weight | 253.02 |
| Purity | 96+ |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 244.6±40.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 16583473 |
| SMILES | O=Cc1ccc(C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C8H4BrF3O/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-4H |
| InChI Key | MWYYNBYTVFKXSD-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-BROMO-2-METHYLBENZALDEHYDE | 83647-40-9 | 2A-0129682 |
| 3-BROMO-2-NAPHTHALDEHYDE | 89005-11-8 | 2A-0129693 |
| 3-BROMO-4,5-DIETHOXYBENZALDEHYDE | 90109-64-1 | 2A-0129711 |
| 3-BROMO-4-(BROMOMETHYL)BENZONITRILE | 89892-39-7 | 2A-1129732 |
| 3-BROMO-4-(TRIFLUOROMETHYL)ANILINE | 172215-91-7 | 2A-0129743 |
| 3-BROMO-4-(TRIFLUOROMETHYL)BENZOIC ACID | 581813-17-4 | 2A-0129745 |
| 3-BROMO-4-CHLOROPICOLINALDEHYDE | 1289031-51-1 | 2A-0129762 |
| 3-BROMO-4-ETHOXY-5-METHOXYBENZALDEHYDE | 90109-65-2 | 2A-0129772 |
| 3-BROMO-4-ETHOXYBENZALDEHYDE | 108373-05-3 | 2A-0129773 |
| 3-BROMO-4-ISOPROPOXY-5-METHOXYBENZALDEHYDE | 400070-31-7 | 2A-0129807 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA