
CAS Number57332-84-0
Synonyms3-bromo-2-oxo-butyric acid ethyl ester; ethyl 3-bromo-2-oxobutyrate; ethyl 2-oxo-3-bromobutyrate; ethyl 3-bromo-2-oxovalerate; methyl ethyl bromopyruvate; ethyl dl-3-bromo-2-oxobutyrate; Butanoic acid, 3-bromo-2-oxo-, ethyl ester; Ethyl 3-bromo-2-oxobutanoate
Molecular FormulaC6H9BrO3
Molecular Weight209.04
Purity96+%
Density1.5±0.1 g/cm3
Boiling Point213.0±23.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57332-84-0 |
| Catalog No. | 2A-1129700 |
| Chinese Name | 3-溴-2-氧代丁酸乙酯 |
| Synonyms | 3-bromo-2-oxo-butyric acid ethyl ester; ethyl 3-bromo-2-oxobutyrate; ethyl 2-oxo-3-bromobutyrate; ethyl 3-bromo-2-oxovalerate; methyl ethyl bromopyruvate; ethyl dl-3-bromo-2-oxobutyrate; Butanoic acid, 3-bromo-2-oxo-, ethyl ester; Ethyl 3-bromo-2-oxobutanoate |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 |
| Purity | 96+ |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 213.0±23.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2918300090 |
| UN(IATA) | 0 |
| PubChem ID | 16191889 |
| SMILES | CCOC(=O)C(=O)C(C)Br |
| InChI | InChI=1S/C6H9BrO3/c1-3-10-6(9)5(8)4(2)7/h4H,3H2,1-2H3 |
| InChI Key | SIOIQIWIQSMQAG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-BROMO-2-METHOXYANILINE | 116557-46-1 | 2A-0129668 |
| 3-BROMO-2-METHOXYBENZOTRIFLUORIDE | 871352-91-9 | 2A-0129671 |
| 3-BROMO-2-METHYLBENZAMIDE | 919363-09-0 | 2A-0129683 |
| 3-BROMO-2-METHYLPHENOL | 7766-23-6 | 2A-0129689 |
| 3-BROMO-2-METHYLTETRAHYDRO-2H-PYRAN | 156051-16-0 | 2A-0129691 |
| 3-BROMO-3,4-DIHYDROQUINOLIN-2(1H)-ONE | 1131594-73-4 | 2A-0129705 |
| 3-BROMO-4,5-DIFLUOROBENZOIC ACID | 1244642-73-6 | 2A-0129713 |
| 3-BROMO-4,5-DIMETHOXYPHENOL | 93092-14-9 | 2A-0129716 |
| 3-BROMO-4-(DIMETHYLAMINO)BENZOIC ACID | 220844-83-7 | 2A-0129734 |
| 3-BROMO-4-(TRIFLUOROMETHOXY)BENZOIC ACID | 85373-96-2 | 2A-0129742 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA