
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1224604-15-2 |
| Catalog No. | 2A-0129663 |
| Chinese Name | 3-bromo-2-methoxy-5-methylbenzaldehyde |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 233.02 |
| Purity | 96+ |
| EINECS | 0 |
| HTC | 2913000090 |
| UN(IATA) | 0 |
| PubChem ID | 329771490 |
| MDL Number | MFCD07374968 |
| SMILES | COc1c(Br)cc(C)cc1C=O |
| InChI | InChI=1S/C9H9BrO2/c1-6-3-7(5-11)9(12-2)8(10)4-6/h3-5H,1-2H3 |
| InChI Key | CDYURHDIJQGOMM-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-BROMO-2-(BROMOMETHYL)BENZONITRILE | 1233479-42-9 | 2A-0129586 |
| 3-BROMO-2-CHLORO-6-FLUOROBENZALDEHYDE | 1114809-11-8 | 2A-0129607 |
| 3-BROMO-2-FLUORO-5-METHYLBENZALDEHYDE | 1257665-03-4 | 2A-0129628 |
| 3-BROMO-2-FLUORO-6-(TRIFLUORMETHYL)BENZALDEHYDE | 909186-28-3 | 2A-0129632 |
| 3-BROMO-2-HYDROXYBENZALDEHYDE OXIME | 28177-82-4 | 2A-0129655 |
| 3-BROMO-2-METHYLBENZALDEHYDE | 83647-40-9 | 2A-0129682 |
| 3-BROMO-2-NAPHTHALDEHYDE | 89005-11-8 | 2A-0129693 |
| 3-BROMO-4,5-DIETHOXYBENZALDEHYDE | 90109-64-1 | 2A-0129711 |
| 3-BROMO-4-(BROMOMETHYL)BENZONITRILE | 89892-39-7 | 2A-1129732 |
| 3-BROMO-4-(TRIFLUOROMETHYL)ANILINE | 172215-91-7 | 2A-0129743 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA