
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 855836-52-1 |
| Catalog No. | 2A-0129658 |
| Chinese Name | 2-碘-3-溴苯酚 |
| Synonyms | 3-Bromo-2-iodophenol |
| Molecular Formula | C6H4BrIO |
| Molecular Weight | 298.91 |
| Purity | 96+ |
| Density | 2.4±0.1 g/cm3 |
| Boiling Point | 243.9±20.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| EINECS | 0 |
| HTC | 2908199090 |
| UN(IATA) | 0 |
| PubChem ID | 16241740 |
| SMILES | Oc1cccc(Br)c1I |
| InChI | InChI=1S/C6H4BrIO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChI Key | WJJYPSTVJBRTGK-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| 3-AMINO-6-IODOPYRAZINE-2-CARBOXAMIDE | 1244949-61-8 | 2A-0129136 |
| 3-AMINO-6-IODOPYRAZINE-2-CARBOXYLIC ACID | 875781-48-9 | 2A-0129137 |
| 3-BROMO-2-CHLORO-4-IODOPYRIDINE | 884494-53-5 | 2A-0129599 |
| 3-BROMO-2-CHLORO-5-IODOPYRIDINE | 1211586-80-9 | 2A-0129602 |
| 3-BROMO-2-FLUORO-5-IODOPYRIDINE | 697300-72-4 | 2A-0129627 |
| 3-BROMO-4-IODOPYRIDINE | 89167-19-1 | 2A-0129803 |
| 3-BROMO-5-IODOPYRIDIN-2-OL | 637348-81-3 | 2A-0129985 |
| 3-FLUORO-4-IODOPHENOL | 122927-84-8 | 2A-0201548 |
| 3-IODOPHENANTHRENE | 33240-31-2 | 2A-0131705 |
| 3-IODOPYRAZINE-2-CARBONITRILE | 1062608-54-1 | 2A-0131712 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA