
CAS Number20734-66-1
Synonymsaminopyrocatechol; bis(difluorophosphino)amine; 3-Amino-1,2-benzenediol; aminodifluorophosphine; 1,2-dihydroxy-3-aminobenzene; 3-amino-pyrocatechol; 2,3-dihydroxyaniline; aminocatechol; 3-Amino-brenzcatechin; aminodihydroxybenzene; 3-aminobenzene-1,2,diol; 3-Aminobenzene-1,2-diol
Molecular FormulaC6H7NO2
Molecular Weight125.125
Purity96+%
Density1.4±0.1 g/cm3
Boiling Point297.0±25.0 °C at 760 mmHg
EINECS0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20734-66-1 |
| Catalog No. | 2A-0129255 |
| Chinese Name | 3-氨基苯-1,2-二醇 |
| Synonyms | aminopyrocatechol; bis(difluorophosphino)amine; 3-Amino-1,2-benzenediol; aminodifluorophosphine; 1,2-dihydroxy-3-aminobenzene; 3-amino-pyrocatechol; 2,3-dihydroxyaniline; aminocatechol; 3-Amino-brenzcatechin; aminodihydroxybenzene; 3-aminobenzene-1,2,diol; 3-Aminobenzene-1,2-diol |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.125 |
| Purity | 96+ |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 297.0±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| EINECS | 0 |
| HTC | 2922299090 |
| UN(IATA) | 0 |
| PubChem ID | 10261020 |
| InChI | InChI=1S/C6H7NO2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H,7H2 |
| InChI Key | MGBKJKDRMRAZKC-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-AMINO-N-ETHYLBENZENESULFONAMIDE | 56445-08-0 | 2A-0129231 |
| 3-AMINO-N-ISOPROPYLBENZAMIDE | 81882-62-4 | 2A-0129234 |
| 3-AMINO-N-ISOPROPYLBENZENESULFONAMIDE | 118837-66-4 | 2A-0129235 |
| 3-AMINO-N-METHYLBENZENESULFONAMIDE | 459434-40-3 | 2A-0129239 |
| 3-AMINO-N-PHENYLPROPANAMIDE | 57528-64-0 | 2A-0129243 |
| 3-AMINOBUTANOIC ACID HYDROCHLORIDE | 5959-33-1 | 2A-0129266 |
| 3-AMINOCYCLOBUTANOL | 4640-44-2 | 2A-0129272 |
| 3-AMINOCYCLOBUTANONE HYDROCHLORIDE | 1035374-20-9 | 2A-1129274 |
| 3-AMINOCYCLOPENTANOL | 13725-38-7 | 2A-0129281 |
| 3-AMINOCYCLOPENTANOL HYDROCHLORIDE | 1184919-69-4 | 2A-0129282 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA